CAS Number4664-16-8
Synonyms6-Hydroxy-4-methylpyridin-2(1H)-one; 2,6-Dihydroxy-4-methylpyridine; EINECS 225-108-7; 6-Hydroxy-4-methyl-2(1H)-pyridinone; 6-hydroxy-4-methyl-1H-pyridin-2-one; MFCD00040464
Molecular FormulaC6H7NO2
Molecular Weight125.125
Density1.3±0.1 g/cm3
Boiling Point356.2±42.0 °C at 760 mmHg
Melting Point195-198ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4664-16-8 |
| Catalog No. | 2A-9079416 |
| Chinese Name | 2,6-二羟基-4-甲基吡啶 |
| Synonyms | 6-Hydroxy-4-methylpyridin-2(1H)-one; 2,6-Dihydroxy-4-methylpyridine; EINECS 225-108-7; 6-Hydroxy-4-methyl-2(1H)-pyridinone; 6-hydroxy-4-methyl-1H-pyridin-2-one; MFCD00040464 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.125 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 356.2±42.0 °C at 760 mmHg |
| Melting Point | 195-198ºC |
| Water Solubility | Soluble in water. |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2933399090 |
| PubChem ID | 3177704 |
| SMILES | Cc1cc(O)[nH]c(=O)c1 |
| InChI | InChI=1S/C6H7NO2/c1-4-2-5(8)7-6(9)3-4/h2-3H,1H3,(H2,7,8,9) |
| InChI Key | JJHVYGVVMBYCMQ-UHFFFAOYSA-N |
| MSDS | msds/79416_1_4664_16_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3Alpha-hydroxy-7-oxo-5beta-cholanicacid | 4651-67-6 | 2A-9079406 |
| N-(4-Aminophenyl)methanesulfonamide | 53250-82-1 | 2A-9079407 |
| 3-(2-Methylpyrimidin-4-yl)benzene-1-sulfonylchloride | 465514-07-2 | 2A-9079409 |
| Methyl4-chloro-6-MethylNicotinate | 53277-47-7 | 2A-9079410 |
| (2Z)-2-(4-Chlorophenyl)-3-hydroxyprop-2-ene | 53283-56-0 | 2A-9079415 |
| 2-(3-(Trifluoromethoxy)phenyl)ethanamine | 467461-10-5 | 2A-9079419 |
| 1-Chloro-N,N-diMethyl-2-propylamine | 53309-35-6 | 2A-9079423 |
| 3,5-dichloroisatoicanhydride | 4693-00-9 | 2A-9079425 |
| 3-Amino-5-chloro-benzonitrile | 53312-78-0 | 2A-9079426 |
| 3-Amino-4-chlorobenzonitrile | 53312-79-1 | 2A-9079429 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS