
CAS Number529-37-3
Synonyms4-Quinolinol; Chinolin-4-ol; 4-quinolone; 4(1H)-QUINOLINONE; Chinolin-4(1H)-on; Quinolin-4(1H)-one; quinolin-4-one; 1,4-Dihydroquinoline-4-one; HYDROXYQUINOLINE,4; KYNURINE; 4-Hydroxyquinoline; 4-oxo-1,4-dihydroquinoline; quinolin-4-ol
Molecular FormulaC22H22N2O2
Molecular Weight346.433
Density1.3±0.1 g/cm3
Boiling Point313.0±15.0 °C at 760 mmHg
Melting Point200-202ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 529-37-3 |
| Catalog No. | 2A-9079379 |
| Chinese Name | 喹啉-4(1H)-酮 |
| Synonyms | 4-Quinolinol; Chinolin-4-ol; 4-quinolone; 4(1H)-QUINOLINONE; Chinolin-4(1H)-on; Quinolin-4(1H)-one; quinolin-4-one; 1,4-Dihydroquinoline-4-one; HYDROXYQUINOLINE,4; KYNURINE; 4-Hydroxyquinoline; 4-oxo-1,4-dihydroquinoline; quinolin-4-ol |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.433 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 313.0±15.0 °C at 760 mmHg |
| Melting Point | 200-202ºC(lit.) |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2933499090 |
| PubChem ID | 8579 |
| MDL Number | MFCD02666047 |
| SMILES | O=c1cc[nH]c2ccccc12 |
| InChI | InChI=1S/C9H7NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h1-6H,(H,10,11) |
| InChI Key | PMZDQRJGMBOQBF-UHFFFAOYSA-N |
| MSDS | msds/79379_1_529_37_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-[[(4-Methylphenyl)sulfonyl]oxy]-ethanimidicacidethylester | 52913-15-2 | 2A-9079372 |
| 2-(4-Phenylpiperazin-1-yl)propanoicacid | 856929-62-9 | 2A-9079375 |
| O-Nitrophenyloctylether | 37682-29-4 | 2A-9079376 |
| 1,2-Benzenedicarboxylicacid,3-amino-,radicalion(1-) | 857040-74-5 | 2A-9079377 |
| 3-(2,6-DiMethylpiperidin-1-yl)-propylamine | 85723-72-4 | 2A-9079378 |
| 2-Bromo-5-fluorobenzylchloride | 857276-61-0 | 2A-9079381 |
| 1-Bromo-2-hexyldecane | 52997-43-0 | 2A-9079383 |
| [3-(2-Morpholinoethoxy)phenyl]methylamine | 857284-08-3 | 2A-9079384 |
| Ethyl3-aminobutyrate | 5303-65-1 | 2A-9079385 |
| 2-Amino-5-bromo-phenolhydrochloride | 858014-02-5 | 2A-9079387 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA