
CAS Number37466-89-0
Synonyms3-Methoxy-o-phenylenediamine; 3-methoxybenzene-1,2-diamine
Molecular FormulaC7H10N2O
Molecular Weight138.17
Density1.17 g/cm3
Boiling Point286.3ºC at 760 mmHg
Melting Point39-40 °C
AppearanceOff-white to yellow to dark brown solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37466-89-0 |
| Catalog No. | 2A-9079340 |
| Chinese Name | 1,2-二氨基-3-甲氧基苯 |
| Synonyms | 3-Methoxy-o-phenylenediamine; 3-methoxybenzene-1,2-diamine |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 |
| Density | 1.17 g/cm3 |
| Boiling Point | 286.3ºC at 760 mmHg |
| Melting Point | 39-40 °C |
| Appearance | Off-white to yellow to dark brown solid |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| PubChem ID | 226358 |
| SMILES | COc1cccc(N)c1N |
| InChI | InChI=1S/C7H10N2O/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,8-9H2,1H3 |
| InChI Key | BFLWXPJTAKXXKT-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| H-D-Tyr-OmeHCL | 3728-20-9 | 2A-9079328 |
| 3,3-DiMethylpiperidin-4-ol | 373603-88-4 | 2A-9079332 |
| 5-Chloro-2-methoxyphenol | 3743-23-5 | 2A-9079337 |
| 2-Oxo-cycloheptanecarboxylicacidethylester | 52784-32-4 | 2A-9079338 |
| 1-(3-Methyl-2-pyridinyl)-ethanone | 85279-30-7 | 2A-9079339 |
| 4-Methoxycarbonylmethyl-benzoicacidmethylester | 52787-14-1 | 2A-9079341 |
| Tert-butyl5-amino-2-fluorobenzoate | 853070-30-1 | 2A-9079343 |
| 2-Amino-5-methyl-1,3,4-oxadiazol | 52838-39-8 | 2A-9079350 |
| 4-Bromo-2-(trifluoromethoxy)anisole | 853771-88-7 | 2A-9079351 |
| 1,3-Bis(4-carboxyphenoxy)propane | 3753-81-9 | 2A-9079356 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA