CAS Number36878-91-8
SynonymsETHYL 3-OXO-3-(FURAN-3-YL)PROPANOATE; Ethyl beta-oxo-3-furanpropionate; 3-Furanpropanoic acid, β-oxo-, ethyl ester; Ethyl 3-(3-furyl)-3-oxopropanoate; MFCD00011566; ethyl 3-(furan-3-yl)-3-oxopropanoate
Molecular FormulaC9H10O4
Molecular Weight182.173
Density1.2±0.1 g/cm3
Boiling Point268.0±0.0 °C at 760 mmHg
AppearanceColorless to yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 36878-91-8 |
| Catalog No. | 2A-9079307 |
| Chinese Name | β-氧代-3-呋喃丙酸乙酯 |
| Synonyms | ETHYL 3-OXO-3-(FURAN-3-YL)PROPANOATE; Ethyl beta-oxo-3-furanpropionate; 3-Furanpropanoic acid, β-oxo-, ethyl ester; Ethyl 3-(3-furyl)-3-oxopropanoate; MFCD00011566; ethyl 3-(furan-3-yl)-3-oxopropanoate |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.173 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 268.0±0.0 °C at 760 mmHg |
| Appearance | Colorless to yellow liquid |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2932190090 |
| PubChem ID | 463331 |
| SMILES | CCOC(=O)CC(=O)c1ccoc1 |
| InChI | InChI=1S/C9H10O4/c1-2-13-9(11)5-8(10)7-3-4-12-6-7/h3-4,6H,2,5H2,1H3 |
| InChI Key | OVPIQFGJQAQWAJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-(5-Bromo-2-pyridinyl)-4-Ethylpiperazine | 364794-57-0 | 2A-9079266 |
| 4-Amino-2-hydroxy-5-pyrimidinecarboxylicacid | 3650-93-9 | 2A-9079271 |
| 2-(3,4-Dimethoxyphenyl)pyrrolidine | 367281-00-3 | 2A-9079283 |
| Ethyl2-oxopyrrolidine-3-carboxylate | 36821-26-8 | 2A-9079300 |
| 3-Bromo-5-methoxy-1H-indole | 85092-83-7 | 2A-9079301 |
| 1-[4-Bromomethyl]-1H-pyrazole | 368869-85-6 | 2A-9079308 |
| 2-Chloro-5-fluoro-pyridine-3-carbaldehyde | 851484-95-2 | 2A-9079310 |
| 1-Methyl-6-oxo-1,6-dihydropyridine-3-carboxylicacid | 3719-45-7 | 2A-9079322 |
| N-methyl-3-phenyl-5-isoxazolemethanaminehydrochloride | 852227-84-0 | 2A-9079323 |
| 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine | 852227-95-3 | 2A-9079325 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS