
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 367514-88-3 |
| Catalog No. | 2A-9079286 |
| Chinese Name | 盐酸鲁拉西酮 |
| Synonyms | lurasidone monohydrochloride; Lurasidone Hydrochloride; Lurasidone HCl; Lurasidone (Hydrochloride); Latuda; lurasidonhydrochloride |
| Molecular Formula | C28H37ClN4O2S |
| Molecular Weight | 529.14 |
| Purity | ≥98 (HPLC) |
| Melting Point | 198-205°C |
| Appearance | powder |
| Storage Condition | Refrigerator |
| Application | Lurasidone is an antagonist of dopamine D2 and 5-HT7 with IC50 values of 1.68 and 0.495 nM respectively. Lurasidone is also a partial agonist at the 5-HT1A receptor with an IC50 value of 6.75 nM. |
| PubChem ID | 16321835 |
| MDL Number | MFCD18917095 |
| SMILES | Cl.O=C1[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C(=O)N1C[C@@H]4CCCC[C@H]4CN5CCN(CC5)c6nsc7ccccc67 |
| InChI | 1S/C28H36N4O2S.ClH/c33-27-24-18-9-10-19(15-18)25(24)28(34)32(27)17-21-6-2-1-5-20(21)16-30-11-13-31(14-12-30)26-22-7-3-4-8-23(22)35-29-26;/h3-4,7-8,18-21,24-25H,1-2,5-6,9-17H2;1H/t18-,19+,20-,21-,24+,25-;/m0./s1 |
| InChI Key | NEKCRUIRPWNMLK-SCIYSFAVSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/79286_1_367514_88_3.pdf |
| Transport Info | Product Name: Lurasidone Hydrochloride |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Ethylthio)Ethylamine | 36489-03-9 | 2A-9079268 |
| 2,3-Dichloro-4-fluoronitrobenzene | 36556-51-1 | 2A-9079274 |
| 4-(Isopropylsulfonylphenyl)bor | 850567-98-5 | 2A-9079276 |
| 2-Chloro-3,5-difluoronitrobenzene | 36556-59-9 | 2A-9079278 |
| 4-Bromopyridin-2(1H)-One | 36593-37-4 | 2A-9079280 |
| 3-(4-Bromophenyl)-1H-pyrazol-5-ol | 367928-57-2 | 2A-9079290 |
| 4-Cyanothiophenol | 36801-01-1 | 2A-9079294 |
| 1,6-Anhydro-2-azido-2-deoxy-4-o-[(1,1-dimethylEthyl)diphenylsilyl]-beta-D-glucopyranose3-acetate | 850637-35-3 | 2A-9079295 |
| 5-aminoMethyl-4-methylthiazol-2-ylamine | 850852-66-3 | 2A-9079298 |
| 2-Bromoquinolin-4-amine | 36825-35-1 | 2A-9079302 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA