Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 363135-54-0 |
| Catalog No. | 2A-9079249 |
| Chinese Name | 7-羟基喹啉-3-甲醛 |
| Synonyms | 7-HYDROXY-3-QUINOLINECARBALDEHYDE; 7-Hydroxy-quinoline-3-carbaldehyde |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 267.08 |
| Purity | ≥98.0 (HPLC) |
| Density | 1.364g/cm3 |
| Boiling Point | 392.2ºC at 760 mmHg |
| Appearance | powder |
| HTC | 2933499090 |
| PubChem ID | 329764685 |
| MDL Number | MFCD00137823 |
| SMILES | OC(=O)c1cc2cc(Br)ccc2cc1O |
| InChI | 1S/C11H7BrO3/c12-8-2-1-6-5-10(13)9(11(14)15)4-7(6)3-8/h1-5,13H,(H,14,15) |
| InChI Key | XZWXQSGFZHRDNB-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2372925 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/79249_1_363135_54_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Bromo-4-chlorobenzothiazole | 3622-40-0 | 2A-9079220 |
| 2-Bromothiazole-4-carboxamide | 848501-94-0 | 2A-9079226 |
| 4-Bromo-7H-pyrrolo[2,3-d]pyrimidin-2-ylamine | 848694-32-6 | 2A-9079228 |
| 2-Amino-4-chloropyrimidine-5-carboxaldehyde | 848697-17-6 | 2A-9079230 |
| 1,3,4-Thiadiazole-2-sulfonylchloride | 362521-36-6 | 2A-9079237 |
| Tert-butyl4-(5-formyl-4-methylthiazol-2-yl)piperidine-1-carboxylate | 850374-97-9 | 2A-9079255 |
| 2-Isocyanato-4-methylthiophene | 850375-10-9 | 2A-9079256 |
| 2H-1,2,4-triazole-3-carbonitrile | 3641-10-9 | 2A-9079259 |
| Ethyl2-amino-3-bromo-5-pyridinecarboxylate | 850429-51-5 | 2A-9079260 |
| 2-Bromo-1-ethoxymethylimidazole | 850429-54-8 | 2A-9079262 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS