
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 82477-61-0 |
| Catalog No. | 2A-9079096 |
| Chinese Name | 2-氯-4,6-二甲氧基苯甲醛 |
| Synonyms | 2-Chloro-4,6-dimehoxybenzaldehyde; 6-chloro-2,4-dimethoxy-benzaldehyde |
| Molecular Formula | C9H9O3Cl1 |
| Molecular Weight | 200.62 |
| Density | 1.245g/cm3 |
| Boiling Point | 326ºC at 760 mmHg |
| Melting Point | 79-80ºC |
| Storage Condition | Room temperature, inert atmosphere |
| HTC | 2913000090 |
| PubChem ID | 5638537 |
| MDL Number | MFCD05863686 |
| SMILES | COc1cc(Cl)c(C=O)c(OC)c1 |
| InChI | InChI=1S/C9H9ClO3/c1-12-6-3-8(10)7(5-11)9(4-6)13-2/h3-5H,1-2H3 |
| InChI Key | WNIGZICIZZIUER-UHFFFAOYSA-N |
| MSDS | msds/79096_1_82477_61_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 5-(3-TrifluoroMethylphenyl)-2H-pyrazol-3-ylamine | 209224-91-9 | 2A-9078974 |
| 2-Pyridone-6-carboxaldehyde | 358751-77-6 | 2A-9078976 |
| 3-Iodo-5-(trifluoromethyl)-2-pyridinylamine(en) | 211308-82-6 | 2A-9079018 |
| Benzoicacid,2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) | 214360-71-1 | 2A-9079063 |
| 3-(Bromomethyl)phenylboronicacidpinacolester | 214360-74-4 | 2A-9079064 |
| 3-Butoxycarbonylphenylboronicacid | 827300-04-9 | 2A-9079103 |
| [3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]carbamicacidtert-butylester | 832114-05-3 | 2A-0202353 |
| N-(2-DimethylaminoEthyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide | 832114-11-1 | 2A-9079119 |
| 3-(Methylcarbamoyl)benzeneboronicacid | 832695-88-2 | 2A-9079121 |
| 5-Bromo-1-(difluoromethyl)pyridin-2(1H)-one | 832735-61-2 | 2A-9079124 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA