
CAS Number21452-14-2
Synonyms2-Amino-4-methyl-1,3-thiazole-5-carboxanilide 2-Amino-4-methyl-N-phenyl-5-thiazolecarboxamide; 2-amino-4-methyl-N-phenyl-5-thiazolecarboxamide; 2-amino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide; 2-Amino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide; 2-Amino-4-Methyl-N-Phenyl-5-Thiazolecarboxamide; 2-amino-4-methyl-1,3-thiazole-5-carboxanilide
Molecular FormulaC11H11N3OS
Molecular Weight233.29000
Density1.375g/cm3
Boiling Point354.5ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21452-14-2 |
| Catalog No. | 2A-9079068 |
| Chinese Name | 拌种灵 |
| Synonyms | 2-Amino-4-methyl-1,3-thiazole-5-carboxanilide 2-Amino-4-methyl-N-phenyl-5-thiazolecarboxamide; 2-amino-4-methyl-N-phenyl-5-thiazolecarboxamide; 2-amino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide; 2-Amino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide; 2-Amino-4-Methyl-N-Phenyl-5-Thiazolecarboxamide; 2-amino-4-methyl-1,3-thiazole-5-carboxanilide |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.29000 |
| Density | 1.375g/cm3 |
| Boiling Point | 354.5ºC at 760mmHg |
| Storage Condition | Warehouse ventilation and low temperature drying |
| HTC | 2934100017 |
| PubChem ID | 4945905 |
| SMILES | Cc1nc(N)sc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H11N3OS/c1-7-3-2-4-8(5-7)14-10(15)9-6-13-11(12)16-9/h2-6H,1H3,(H2,12,13)(H,14,15) |
| InChI Key | CACOMUHPQMDEJQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Iodo-1,2-benzenediamine | 21304-38-1 | 2A-9079042 |
| Methyl4-amino-2,5-dimethylbenzoate | 21339-74-2 | 2A-9079043 |
| (5R,2S)-2,5-Diaminoadipicaciddihydrochloride | 213686-09-0 | 2A-9079047 |
| 6-Fluoroisoquinolin-1(2H)-one | 214045-85-9 | 2A-9079049 |
| 3-Methylbenzene-1-carboxylicanhydride | 21436-44-2 | 2A-9079065 |
| 1,2-PROPANEDIOL DINITRATE | 6423-43-4 | 2A-9079069 |
| 3-Bromo-2-butanone | 814-75-5 | 2A-9079074 |
| 4-T-Butylpropiophone | 81561-77-5 | 2A-9079076 |
| 7-Nitro-2H-1,4-benzoxazin-3(4H)-one | 81721-86-0 | 2A-9079079 |
| Methyl2-pentenoate | 818-59-7 | 2A-9079081 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA