
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 359-06-8 |
| Catalog No. | 2A-9078978 |
| Chinese Name | 氟代乙酰氯 |
| Synonyms | 2-fluoroacetyl chloride; Fluoroacetyl chloride |
| Molecular Formula | C2H2ClFO |
| Molecular Weight | 96.488 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 49.8±10.0 °C at 760 mmHg |
| Appearance | liquid |
| HTC | 2915900090 |
| PubChem ID | 8156940 |
| SMILES | O=C(Cl)CF |
| InChI | InChI=1S/C2H2ClFO/c3-2(5)1-4/h1H2 |
| InChI Key | ZBHDTYQJAQDBIH-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(a) |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl3-amino-2-hydroxybenzoate | 35748-34-6 | 2A-9078966 |
| 2-Acetyl-4-cyanophenol | 35794-84-4 | 2A-9078968 |
| 2,8-Bis(trifluromethyl)-4-quinolincarboxylicacid | 35853-50-0 | 2A-9078972 |
| 2-Ethylacrylicacid | 3586-58-1 | 2A-9078975 |
| Thymine-1-aceticacid | 20924-05-4 | 2A-9078977 |
| 4-Chloro-1H-indazol-3-amine | 20925-60-4 | 2A-9078980 |
| 2-Bromo-1,1-difluoroethane | 359-07-9 | 2A-9078981 |
| 2-(4-Methylphenoxy)aniline | 20927-98-4 | 2A-9078984 |
| 2-Bromo-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethan-1-one | 35970-34-4 | 2A-9078985 |
| 2-Amino-N-cyclobutyl-acetamide | 359821-39-9 | 2A-9078986 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA