
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 354512-22-4 |
| Catalog No. | 2A-9078954 |
| Chinese Name | 3-甲氧基-5-硝基苯甲醛 |
| Synonyms | 3-Methoxy-5-nitrobenzaldehyde; Benzaldehyde,3-methoxy-5-nitro |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 197.14 |
| Purity | 97 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 326.5±27.0 °C at 760 mmHg |
| Melting Point | 129-134 °C |
| Appearance | powder |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2913000090 |
| PubChem ID | 329763894 |
| MDL Number | MFCD00016640 |
| SMILES | COc1cc(C=O)c(O)c(c1)[N+]([O-])=O |
| InChI | 1S/C8H7NO5/c1-14-6-2-5(4-10)8(11)7(3-6)9(12)13/h2-4,11H,1H3 |
| InChI Key | CCHTVTHOPTTYSY-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/78954_1_354512_22_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-(Methylthio)pyrimidine-5-boronicacid | 348098-29-3 | 2A-9078925 |
| 2,2-Dimethyltetrahydro-2H-pyran-4-carbaldehyde | 34941-21-4 | 2A-0200600 |
| 3-Amino-4-methoxy-benzaldehyde | 351003-10-6 | 2A-9078937 |
| 1-(4-Cyanophenyl)piperidine-4-carbohydrazide | 352018-91-8 | 2A-9078939 |
| 3-Butoxyphenylboronicacid | 352534-81-7 | 2A-9078945 |
| 2-(Dimethylamino)nicotinaldehyde | 35567-32-9 | 2A-9078956 |
| 2-Methoxy-4-(trifluoromethoxy)-phenylboronicacid | 355836-10-1 | 2A-9078959 |
| Bis[2,8-di(trifluoromethyl)quinolin-4-yl-2-pyridyl]ketone | 35853-55-5 | 2A-9078973 |
| 5-(3-TrifluoroMethylphenyl)-2H-pyrazol-3-ylamine | 209224-91-9 | 2A-9078974 |
| 2-Pyridone-6-carboxaldehyde | 358751-77-6 | 2A-9078976 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA