CAS Number35351-35-0
SynonymsMethyl 5-methyl-3-furoate; 3-Furancarboxylic acid, 5-methyl-, methyl ester; 5-Methyl-furan-carbonsaeure-(3)-methylester; 3-Furancarboxylic acid,5-methyl-,methyl ester; 5-methyl-furan-3-carboxylic acid methyl ester; methyl ester of 5-methyl-3-furoic acid
Molecular FormulaCH3CH2COCH2CH(CH3)CH2CH3
Molecular Weight128.21
Density1.1±0.1 g/cm3
Boiling Point182.5±20.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35351-35-0 |
| Catalog No. | 2A-9078950 |
| Chinese Name | 5-甲基-3-呋喃甲酸甲酯 |
| Synonyms | Methyl 5-methyl-3-furoate; 3-Furancarboxylic acid, 5-methyl-, methyl ester; 5-Methyl-furan-carbonsaeure-(3)-methylester; 3-Furancarboxylic acid,5-methyl-,methyl ester; 5-methyl-furan-3-carboxylic acid methyl ester; methyl ester of 5-methyl-3-furoic acid |
| Molecular Formula | CH3CH2COCH2CH(CH3)CH2CH3 |
| Molecular Weight | 128.21 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 182.5±20.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2932190090 |
| PubChem ID | 46534865 |
| SMILES | COC(=O)c1coc(C)c1 |
| InChI | InChI=1S/C7H8O3/c1-5-3-6(4-10-5)7(8)9-2/h3-4H,1-2H3 |
| InChI Key | UTBIHCRVZWPDGB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-Acetyl-2,2'-bithiophene | 3515-18-2 | 2A-9078938 |
| 5-Iodo-2-phenoxypyridine | 352018-92-9 | 2A-9078941 |
| 3-Methyl-5-nitrobenzoisothiazole | 35272-19-6 | 2A-9078947 |
| Benzo[c][1,2,5]thiadiazole-4-carboxylicacid | 3529-57-5 | 2A-9078948 |
| 2-(1-Methylcyclopropyl)-1,3,4-oxadiazole | 353238-51-4 | 2A-9078949 |
| 6-Nitro-3H-imidazo[4,5-b]pyridine | 3537-09-5 | 2A-9078951 |
| 3,5-Dihydroxypyridine | 3543-02-0 | 2A-9078952 |
| 2-Amino-5-iodo-4-Methylpyridine | 356561-08-5 | 2A-9078961 |
| 4,6-DiMethylpyrimidine-2-sulfonamide | 35762-76-6 | 2A-9078967 |
| Pyrido[2,3-b]pyrazin-6(5H)-one | 35808-45-8 | 2A-9078970 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS