
CAS Number16320-04-0
SynonymsD-GESTRINONE; Dimetriose; TridoMose; 13b-Ethyl-17a-ethynyl-D4,9,11-gonatriene-17b-ol-3-one; (17a)-13-Ethyl-17-hydroxy-18,19-dinorpregna-4,9,11-trien-20-yn-3-one; 13b-Ethyl-17a-ethynyl-17b-hydroxy-4,9,11-gonatrien-3-one; Dimetrose; MFCD00865561; gestrigone; (17α)-13-Ethyl-17-hydroxy-18,19-dinorpregna-4,9,11-trien-20-yn-3-one; Gestrinone; 13-ETHYL-17α-ETHYNYL-17β-HYDROXY-4,9,11-GONATRIENE-3-ONE; NeMestran
Molecular FormulaC21H24O2
Molecular Weight308.41
Purity≥97 (HPLC)%
Density1.2±0.1 g/cm3
Boiling Point507.6±50.0 °C at 760 mmHg
Melting Point154ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16320-04-0 |
| Catalog No. | 2A-9007895 |
| Chinese Name | 孕三烯酮 |
| Synonyms | D-GESTRINONE; Dimetriose; TridoMose; 13b-Ethyl-17a-ethynyl-D4,9,11-gonatriene-17b-ol-3-one; (17a)-13-Ethyl-17-hydroxy-18,19-dinorpregna-4,9,11-trien-20-yn-3-one; 13b-Ethyl-17a-ethynyl-17b-hydroxy-4,9,11-gonatrien-3-one; Dimetrose; MFCD00865561; gestrigone; (17α)-13-Ethyl-17-hydroxy-18,19-dinorpregna-4,9,11-trien-20-yn-3-one; Gestrinone; 13-ETHYL-17α-ETHYNYL-17β-HYDROXY-4,9,11-GONATRIENE-3-ONE; NeMestran |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.41 |
| Purity | ≥97 (HPLC) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 507.6±50.0 °C at 760 mmHg |
| Melting Point | 154ºC |
| Appearance | powder |
| Storage Condition | -20°C Freezer |
| Application | Gestrinone (R2323) is a synthetic steroid hormone used to treat endometriosis. The IC50 value for inhibiting leiomyoma is 43.67 μM. |
| MDL Number | MFCD00865561 |
| SMILES | O[C@@]1(C#C)CC[C@@]2([H])[C@]3([H])CCC4=CC(CCC4=C3C=C[C@@]21CC)=O |
| InChI | 1S/C21H24O2/c1-3-20-11-9-17-16-8-6-15(22)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,9,11,13,18-19,23H,3,5-8,10,12H2,1H3/t18-,19+,20+,21+/m1/s1 |
| InChI Key | BJJXHLWLUDYTGC-ANULTFPQSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/7895_1_16320_04_0.pdf |
| Transport Info | Product Name: Gestrinone |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Fructose-1,6-diphosphate sodium salt | 81028-91-3 | 2A-9007883 |
| Furagin | 1672-88-4 | 2A-9007884 |
| Ganclclovir, [8-3H] | 2A-107888 | 2A-9007888 |
| GCLE | 104146-10-3 | 2A-9007889 |
| GEO | 53956-74-4 | 2A-9007894 |
| GHYH | 54639-48-4 | 2A-9007896 |
| Gloriosine | 7411-12-3 | 2A-9007897 |
| Glucose pentaacetate | 604-68-2 | 2A-9007898 |
| Glutacondianil hydrochloride | 1497-49-0 | 2A-9007899 |
| Glycinamide hydrochloride | 1668-10-6 | 2A-9007900 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA