
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34231-22-6 |
| Catalog No. | 2A-9078888 |
| Chinese Name | 3-(氨甲基)苯甲醇 |
| Synonyms | m-aminomethylbenzyl alcohol; [3-(hydroxymethyl)phenyl]methylamine; 3-(aminomethyl)phenylmethanol; 3-(aminomethyl)benzyl alcohol |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.17900 |
| Density | 1.113g/cm3 |
| Boiling Point | 277.943ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2922199090 |
| PubChem ID | 37382163 |
| SMILES | NCc1cccc(CO)c1 |
| InChI | InChI=1S/C8H11NO/c9-5-7-2-1-3-8(4-7)6-10/h1-4,10H,5-6,9H2 |
| InChI Key | KCTYUINIEPILPS-UHFFFAOYSA-N |
| MSDS | msds/78888_1_34231_22_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| (3-Chloro-5-nitrophenyl)methanol | 79944-62-0 | 2A-9078680 |
| 2-Fluoro-6-aminotoluene | 433-86-7 | 2A-9078753 |
| 9H-Fluorene-9,9-dimethanol | 4425-93-8 | 2A-9078759 |
| (5-Bromopyrimidin-4-yl)methanol | 811450-15-4 | 2A-9078865 |
| Bis(3,5,3',5'-dimethoxydibenzylideneacetone)palladium(0) | 811862-77-8 | 2A-9078874 |
| 2-(4-Methylpiperazin-2-yl)ethanol | 211053-48-4 | 2A-9079016 |
| 2-Chloro-6-fluorophenylethanol | 214262-86-9 | 2A-9079055 |
| 3,4-Dihydro-2H-1,4-benzoxazin-2-ylmethanol | 82756-74-9 | 2A-9079104 |
| (4-Pyrid-3-ylphenyl)methanol | 217189-04-3 | 2A-9079223 |
| 2-(4,6-Dichloropyrimidin-5-yl)ethanol | 853680-74-7 | 2A-9079346 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA