
CAS Number452-09-5
Synonyms4-Chlor-2-fluor-anisol; 4-chloro-2-fluoro-anisole; MFCD00672964; 4-CHLORO-2-FLUORO-1-METHOXY-BENZENE; Methyl-(2-fluor-4-chlor-phenyl)-aether; Anisole,4-chloro-2-fluoro; 2-Fluor-4-chlor-1-methoxy-benzol; 2-fluoro-4-chloroanisole; gr cf do1; Benzene,4-chloro-2-fluoro-1-methoxy
Molecular FormulaC7H6ClFO
Molecular Weight160.58
Density1.294 g/mL at 25 °C(lit.)
Boiling Point160 °C(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 452-09-5 |
| Catalog No. | 2A-9078809 |
| Chinese Name | 4-氯-2-氟苯甲醚 |
| Synonyms | 4-Chlor-2-fluor-anisol; 4-chloro-2-fluoro-anisole; MFCD00672964; 4-CHLORO-2-FLUORO-1-METHOXY-BENZENE; Methyl-(2-fluor-4-chlor-phenyl)-aether; Anisole,4-chloro-2-fluoro; 2-Fluor-4-chlor-1-methoxy-benzol; 2-fluoro-4-chloroanisole; gr cf do1; Benzene,4-chloro-2-fluoro-1-methoxy |
| Molecular Formula | C7H6ClFO |
| Molecular Weight | 160.58 |
| Density | 1.294 g/mL at 25 °C(lit.) |
| Boiling Point | 160 °C(lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2909309090 |
| PubChem ID | 75643 |
| SMILES | COc1ccc(Cl)cc1F |
| InChI | InChI=1S/C7H6ClFO/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3 |
| InChI Key | QIUCVZDNIUACJN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2-Dideutero-1,1,2,2-tetrachloroethane | 33685-54-0 | 2A-9078803 |
| 2-Chloro-5-iodo-4-pyridinamine | 800402-12-4 | 2A-9078805 |
| N-Carbobenzyloxy-l-asparticanhydride | 4515-23-5 | 2A-9078806 |
| 4-Bromo-2-nitroanisole | 33696-00-3 | 2A-9078807 |
| 4-Bromo-2,6-bis(1-methylEthyl)benzenamine | 80058-84-0 | 2A-9078808 |
| 3-Furylmethylamine | 4543-47-9 | 2A-9078811 |
| Chenopodium oil | 8006-99-3 | 2A-9078812 |
| 4-(1-Methylpiperidin-4-yl)aniline | 454482-12-3 | 2A-9078814 |
| 1-(2-Chloroethoxy)-4-methoxybenzene | 3383-74-2 | 2A-9078815 |
| 4-Iodo-2-methoxyaniline | 338454-80-1 | 2A-9078816 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA