CAS Number33689-29-1
Synonyms1-Hydroxy-cyclopropancarbonsaeure-methylester; Cyclopropanecarboxylic acid, 1-hydroxy-, methyl ester; methyl 1-hydroxylcyclopropanecarboxylate; METHYL 1-HYDROXY-1-CYCLOPROPANECARBOXYLATE; Hydroxy-cyclopropanecarboxylic acid methyl ester; Methyl 1-hydroxy-1-cyclopropane carboxylate; 1-Hydroxycyclopropanecarboxylic Acid Methyl Ester; Methyl 1-hydroxycyclopropanecarboxylate
Molecular FormulaC5H8O3
Molecular Weight116.12
Density1.3±0.1 g/cm3
Boiling Point134.6±13.0 °C at 760 mmHg
AppearanceTransparent yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 33689-29-1 |
| Catalog No. | 2A-9078804 |
| Chinese Name | 1-羟基-1-环丙羧酸甲酯 |
| Synonyms | 1-Hydroxy-cyclopropancarbonsaeure-methylester; Cyclopropanecarboxylic acid, 1-hydroxy-, methyl ester; methyl 1-hydroxylcyclopropanecarboxylate; METHYL 1-HYDROXY-1-CYCLOPROPANECARBOXYLATE; Hydroxy-cyclopropanecarboxylic acid methyl ester; Methyl 1-hydroxy-1-cyclopropane carboxylate; 1-Hydroxycyclopropanecarboxylic Acid Methyl Ester; Methyl 1-hydroxycyclopropanecarboxylate |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 134.6±13.0 °C at 760 mmHg |
| Appearance | Transparent yellow liquid |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2918199090 |
| PubChem ID | 3151929 |
| SMILES | COC(=O)C1(O)CC1 |
| InChI | InChI=1S/C5H8O3/c1-8-4(6)5(7)2-3-5/h7H,2-3H2,1H3 |
| InChI Key | KPJWVJURYXOHOO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Amino-3-(trifluoromethyl)phenol | 445-04-5 | 2A-9078768 |
| Methoxypyridine-3-boronicacid,pinacolester | 445264-60-8 | 2A-9078769 |
| Methyl1-aminocyclohexanecarboxylate | 4507-57-7 | 2A-9078792 |
| 8-Benzyl-2,8-diazaspiro[4.5]decane | 336191-15-2 | 2A-9078795 |
| Tert-butyl8-benzyl-2,8-diazaspiro[4.5]decane-2-carboxylate | 336191-16-3 | 2A-9078796 |
| 6-Methoxy-2-Methylpyridin-3-ylboronicacid | 459856-12-3 | 2A-9078817 |
| Cyclopentanecarbohydrazide | 3400-07-5 | 2A-9078856 |
| 2-BromopriopionaldehydeDiethylacetal | 3400-55-3 | 2A-9078858 |
| 2-Bromo-4-(trifluoromethyl)phenol | 81107-97-3 | 2A-9078864 |
| 3-Isopropoxycarbonylphenylboronicacid | 342002-80-6 | 2A-9078885 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS