
CAS Number329314-68-3
Synonyms2,4-Difluoro-5-methylbenzoni trile; 2,4-Difluoro-5-methylbenzonitrile; 2,4,6-TRIFLUORO-3-HYDROXYPHENYLBORONIC ACID; NCR BF DF E1; 2,4-difluoro-5-methyl-benzonitrile
Molecular FormulaC8H5F2N
Molecular Weight153.13
Density1.2±0.1 g/cm3
Boiling Point212.8±35.0 °C at 760 mmHg
Melting Point43-50℃
AppearanceCrystalline Solid | Cream to yellow
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 329314-68-3 |
| Catalog No. | 2A-9078719 |
| Chinese Name | 2,4-二氟-5-甲基苯腈 |
| Synonyms | 2,4-Difluoro-5-methylbenzoni trile; 2,4-Difluoro-5-methylbenzonitrile; 2,4,6-TRIFLUORO-3-HYDROXYPHENYLBORONIC ACID; NCR BF DF E1; 2,4-difluoro-5-methyl-benzonitrile |
| Molecular Formula | C8H5F2N |
| Molecular Weight | 153.13 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 212.8±35.0 °C at 760 mmHg |
| Melting Point | 43-50℃ |
| Appearance | Crystalline Solid | Cream to yellow |
| Storage Condition | room temperature |
| HTC | 2926909090 |
| PubChem ID | 15785937 |
| SMILES | Cc1cc(C#N)c(F)cc1F |
| InChI | InChI=1S/C8H5F2N/c1-5-2-6(4-11)8(10)3-7(5)9/h2-3H,1H3 |
| InChI Key | QUUFHRSTBTZWMA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dioxo-2,4-dihydro-1H-benzo[d][1,3]oxazine-6-carboxylicacid | 77423-13-3 | 2A-9078397 |
| Ethyl2-(2,4-dimethylthiazol-5-yl)acetate | 405921-41-7 | 2A-9078468 |
| 2,4,5-Trifluoroiodobenzene | 41860-63-3 | 2A-9078582 |
| 4-Methyl-1-piperazinebutanamine | 4553-32-6 | 2A-9078623 |
| 2,4-Dichloro-8-methoxyquinoline | 32608-29-0 | 2A-9078673 |
| 5-AminoMethylpyrimidine-2,4-diamine | 4458-18-8 | 2A-9078771 |
| 2,4-DichlorophenEthylalcohol | 81156-68-5 | 2A-9078868 |
| Pyridine,2,4-dichloro-5-iodo- | 343781-49-7 | 2A-9078899 |
| 2,4-Dimethyl-5-nitroaniline | 2124-47-2 | 2A-9079036 |
| 2,4-Diiodopyridine | 83674-71-9 | 2A-9079138 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA