![2,2'-(9,9-Dimethyl-9H-fluorene-2,7-diyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] structure, CAS 325129-69-9](/structures/80000/78661_2_325129_69_9.png)
CAS Number325129-69-9
Synonymsamtb256; 2,2'-(9,9-Dimethyl-9H-fluorene-2,7-diyl)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane); 2,2',6,6'-tetrachlorodibenzyl ether; 9,9-DiMethylfluorene-2,7-diboronic acid bis(pinacol) ester; 1,3,2-DIOXABOROLANE, 2,2'-(9,9-DIMETHYL-9H-FLUORENE-2,7-DIYL)BIS[4,4,5,5-TETRAMETHYL]; 2,2'-(9,9-Dimethyl-9H-fluorene-2,7-diyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane]
Molecular FormulaC27H36B2O4
Molecular Weight446.2
Density1.1±0.1 g/cm3
Boiling Point559.4±43.0 °C at 760 mmHg
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 325129-69-9 |
| Catalog No. | 2A-9078661 |
| Chinese Name | 9,9-二甲基基芴-2,7-二硼酸二频哪醇酯 |
| Synonyms | amtb256; 2,2'-(9,9-Dimethyl-9H-fluorene-2,7-diyl)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane); 2,2',6,6'-tetrachlorodibenzyl ether; 9,9-DiMethylfluorene-2,7-diboronic acid bis(pinacol) ester; 1,3,2-DIOXABOROLANE, 2,2'-(9,9-DIMETHYL-9H-FLUORENE-2,7-DIYL)BIS[4,4,5,5-TETRAMETHYL]; 2,2'-(9,9-Dimethyl-9H-fluorene-2,7-diyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] |
| Molecular Formula | C27H36B2O4 |
| Molecular Weight | 446.2 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 559.4±43.0 °C at 760 mmHg |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature, dry |
| PubChem ID | 33867494 |
| SMILES | CC1(C)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C27H36B2O4/c1-23(2)21-15-17(28-30-24(3,4)25(5,6)31-28)11-13-19(21)20-14-12-18(16-22(20)23)29-32-26(7,8)27(9,10)33-29/h11-16H,1-10H3 |
| InChI Key | RVFLMSKITNJVRB-UHFFFAOYSA-N |
| Transport Info | Product name: 2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9-dimethylfluorene |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,4-Dimethoxybenzhydrazide | 41764-74-3 | 2A-9078576 |
| 6-(Methylthio)pyridin-3-ylboronicacid | 321438-86-2 | 2A-9078606 |
| (Difluoromethyl)benzene | 455-31-2 | 2A-9078619 |
| 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde | 79418-78-3 | 2A-9078625 |
| Methyl 5-Bromo-2-(bromomethyl)benzoate | 79670-17-0 | 2A-9078647 |
| Methyl-1-(trifluoroMethyl)cyclopropanecarboxylate | 208242-25-5 | 2A-9078701 |
| Ethyl2,3-dihydrobenzo[b][1,4]dioxine-6-carboxylate | 20825-87-0 | 2A-9078704 |
| 2-Bromo-4-methoxybenzaldehyde | 43192-31-0 | 2A-9078743 |
| 4-Amino-3-(trifluoromethyl)phenol | 445-04-5 | 2A-9078768 |
| Methoxypyridine-3-boronicacid,pinacolester | 445264-60-8 | 2A-9078769 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA