
CAS Number31825-95-3
Synonyms2-Methyl-4-thiazolecarboxamide; 2-methyl-thiazole-4-carbothioic acid amide; 2-Methyl-thiazol-4-carbonsaeure-amide; 4-THIAZOLECARBOXAMIDE,2-METHYL; 2-Methyl-4-thiazolcarboxamide; 2-methyl-thiazole-4-carboxylic acid amide
Molecular Formula(CH3)2CHCH2CH(OH)CH3
Molecular Weight102.17
Density1.327g/cm3
Boiling Point341.3ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31825-95-3 |
| Catalog No. | 2A-9078526 |
| Chinese Name | 2-甲基噻唑-4-甲酰胺 |
| Synonyms | 2-Methyl-4-thiazolecarboxamide; 2-methyl-thiazole-4-carbothioic acid amide; 2-Methyl-thiazol-4-carbonsaeure-amide; 4-THIAZOLECARBOXAMIDE,2-METHYL; 2-Methyl-4-thiazolcarboxamide; 2-methyl-thiazole-4-carboxylic acid amide |
| Molecular Formula | (CH3)2CHCH2CH(OH)CH3 |
| Molecular Weight | 102.17 |
| Density | 1.327g/cm3 |
| Boiling Point | 341.3ºC at 760mmHg |
| Storage Condition | Room temperature, protected from light, dry and se |
| HTC | 2934100090 |
| PubChem ID | 17199161 |
| SMILES | Cc1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C5H6N2OS/c1-3-7-4(2-9-3)5(6)8/h2H,1H3,(H2,6,8) |
| InChI Key | JFBXSNFENTXBSX-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1H-Imidazole-2-carbonitrile | 31722-49-3 | 2A-9078518 |
| 3-Isopropyl-1-methyl-1H-pyrazole-5-carboxylicacid | 78208-73-8 | 2A-9078520 |
| 3-Methoxy-5-Methylpyridine | 78210-42-1 | 2A-9078521 |
| 4-Hydroxymethyl-pyridine-2-carboxylicacidmethylester | 317335-15-2 | 2A-9078522 |
| 4-Methyl-1H-indazole | 3176-63-4 | 2A-9078523 |
| 5-Chloro-2-hydroxypyridine | 4214-79-3 | 2A-9078532 |
| 1-(3-Bromophenyl)-5-methyl-1H-pyrazole-3-carboxamide | 784142-83-2 | 2A-9078542 |
| 2-Propionylfuran | 3194-15-8 | 2A-9078547 |
| 5-Bromo-4-(trifluoromethyl)pyrimidine | 785777-88-0 | 2A-9078548 |
| 2-Acetylindole | 4264-35-1 | 2A-9078552 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA