
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 404-98-8 |
| Catalog No. | 2A-9078459 |
| Chinese Name | (3-氟苯氧基)乙酸 |
| Synonyms | 2-(3-Fluorophenoxy)acetic acid; (3-Fluorophenoxy)acetic acid |
| Molecular Formula | C8H7FO3 |
| Molecular Weight | 170.138 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 265.9±15.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| PubChem ID | 3999028 |
| SMILES | O=C(O)COc1cccc(F)c1 |
| InChI | InChI=1S/C8H7FO3/c9-6-2-1-3-7(4-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| InChI Key | DMYZZZCPJOWSNT-UHFFFAOYSA-N |
| MSDS | msds/78459_1_404_98_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Fluoro-3-iodobenzoicacid | 403-18-9 | 2A-9078445 |
| 3,5,6-Trichloropicolinicacid | 40360-44-9 | 2A-9078448 |
| N,4-DiMethylpyridin-3-amine | 77862-24-9 | 2A-9078449 |
| 2-Methyloctanal | 7786-29-0 | 2A-9078451 |
| 4,5-Dichloropyrimidin-2-amine | 403854-21-7 | 2A-9078452 |
| 1-Cbz-4-methylaminopieridine | 405057-75-2 | 2A-9078460 |
| N-[[4-(dimethylamino)phenyl]methyl]-1,2,3,4-tetrahydro-7-methoxy-n-[4-(1-methylEthyl)phenyl]-1-naphthalenecarboxamidehydrochloride | 405098-33-1 | 2A-9078462 |
| Sarcosine-N-dithiocarbamate | 40520-03-4 | 2A-9078465 |
| Cyclopentane-1,3-dicarboxylicacid | 4056-78-4 | 2A-9078467 |
| N-methyl-1-(1-Methylpiperidin-4-yl)methanamine | 405928-19-0 | 2A-9078469 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA