
CAS Number30162-37-9
Synonyms3-Pyridylthiourea; 1-(3-PYRIDYL)-2-THIOUREA; F1906-0019; pyrid-3-yl-thiourea; EINECS 250-075-0; 3-Pyridinylthiourea; N-(3-Pyridyl)thiourea; MFCD00014635
Molecular FormulaC6H7N3S1
Molecular Weight153.21
Density1.382 g/cm3
Boiling Point298.7ºC at 760 mmHg
Melting Point159 °C
Appearancesolid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30162-37-9 |
| Catalog No. | 2A-9078412 |
| Chinese Name | 3-吡啶硫脲 |
| Synonyms | 3-Pyridylthiourea; 1-(3-PYRIDYL)-2-THIOUREA; F1906-0019; pyrid-3-yl-thiourea; EINECS 250-075-0; 3-Pyridinylthiourea; N-(3-Pyridyl)thiourea; MFCD00014635 |
| Molecular Formula | C6H7N3S1 |
| Molecular Weight | 153.21 |
| Density | 1.382 g/cm3 |
| Boiling Point | 298.7ºC at 760 mmHg |
| Melting Point | 159 °C |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2933399090 |
| PubChem ID | 450880 |
| MDL Number | MFCD00014635 |
| SMILES | NC(=S)Nc1cccnc1 |
| InChI | InChI=1S/C6H7N3S/c7-6(10)9-5-2-1-3-8-4-5/h1-4H,(H3,7,9,10) |
| InChI Key | CFOJQUGXHMGMOT-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/78412_1_30162_37_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(2,6-Diflorophenyl)-3-oxo-butyricacidmethylester | 774231-71-5 | 2A-9078399 |
| 1-(3,4-Dimethoxyphenyl)-2,2,2-trifluoroethanone | 300374-83-8 | 2A-9078400 |
| Spiro-6-chloro-[2H-1-benzopyran-2,4'-piperidin]-4(3H)-one | 300552-38-9 | 2A-9078403 |
| 4,5-Dichloro-6-Methylpyrimidin-2-amine | 7749-60-2 | 2A-9078405 |
| 2-(Quinolin-3-yl)ethanamine | 776333-52-9 | 2A-9078410 |
| Cyclobutylmethylketone | 3019-25-8 | 2A-9078415 |
| 2-(3,4-DiMethylphenyl)acetonitrile | 3020-06-2 | 2A-9078416 |
| 3,5-Dichlorobenzylbromide | 7778-01-0 | 2A-9078417 |
| 1-(2-Pyridinyl)-Cyclopentanecarbonitrile | 400727-04-0 | 2A-9078418 |
| (1,3-Dimethyl-1H-pyrazol-4-yl)methanamine | 400756-28-7 | 2A-9078419 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA