
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 773134-65-9 |
| Catalog No. | 2A-9078381 |
| Chinese Name | 2,3-二氟苯甲酸乙酯 |
| Synonyms | benzoic acid,2,3-difluoro-,ethyl ester |
| Molecular Formula | C9H8F2O2 |
| Molecular Weight | 186.16 |
| Density | 1.222g/cm3 |
| Boiling Point | 233.1ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2916399090 |
| PubChem ID | 3189210 |
| SMILES | CCOC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C9H8F2O2/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h3-5H,2H2,1H3 |
| InChI Key | MBTGWZLPWWAHCU-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Aminomethyl)-4-methyl-5(4H)-oxazolone | 772327-44-3 | 2A-9078369 |
| 5-Methoxynicotinonitrile | 298204-74-7 | 2A-9078370 |
| 1-(4-Fluorophenyl)cyclopropanecarboxylicacid | 773100-29-1 | 2A-9078375 |
| 1,3-Dibromo-2-(2-bromoethoxy)benzene | 206347-32-2 | 2A-9078377 |
| 4-Amino-2,5-difluorobenzoicacid | 773108-64-8 | 2A-9078379 |
| 4-Thiophen-2-ylphenol | 29886-65-5 | 2A-9078384 |
| 5-Cyclohexyl-o-anisidine | 206559-52-6 | 2A-9078386 |
| N-Ethyl-N-(heptadecafluorooctyl-so2)glycinksalt | 2991-51-7 | 2A-9078390 |
| 4-(2,6-Diflorophenyl)-3-oxo-butyricacidmethylester | 774231-71-5 | 2A-9078399 |
| 1-(3,4-Dimethoxyphenyl)-2,2,2-trifluoroethanone | 300374-83-8 | 2A-9078400 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA