
CAS Number20576-82-3
Synonymsterephthalic acid-mono-t-butyl ester; 1,4-Benzenedicarboxylic acid, mono(1,1-dimethylethyl) ester; tert-Butyl 4-carboxybenzoate; 4-(tert-Butoxycarbonyl)benzoic acid; 4-{[(2-Methyl-2-propanyl)oxy]carbonyl}benzoic acid
Molecular FormulaC12H14O4
Molecular Weight222.24
Density1.2±0.1 g/cm3
Boiling Point351.8±25.0 °C at 760 mmHg
Melting Point209-212(dec.)ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20576-82-3 |
| Catalog No. | 2A-9078356 |
| Chinese Name | 4-(叔丁氧基羰基)苯甲酸 |
| Synonyms | terephthalic acid-mono-t-butyl ester; 1,4-Benzenedicarboxylic acid, mono(1,1-dimethylethyl) ester; tert-Butyl 4-carboxybenzoate; 4-(tert-Butoxycarbonyl)benzoic acid; 4-{[(2-Methyl-2-propanyl)oxy]carbonyl}benzoic acid |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 351.8±25.0 °C at 760 mmHg |
| Melting Point | 209-212(dec.)ºC |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| PubChem ID | 3188982 |
| SMILES | CC(C)(C)OC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H14O4/c1-12(2,3)16-11(15)9-6-4-8(5-7-9)10(13)14/h4-7H,1-3H3,(H,13,14) |
| InChI Key | ILBDCOLCHNVWNS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 5H-Pyrrolo[2,3-b]pyrazine-7-aceticacid | 20322-09-2 | 2A-9078262 |
| 2,3,6-Trichloroquinoxaline | 2958-87-4 | 2A-9078318 |
| 1-N-Boc-4-(4-Bromophenyl)piperidine | 769944-78-7 | 2A-9078327 |
| Tert-butyl2-oxospiro[indoline-3,3'-pyrrolidine]-1'-carboxylate | 205383-87-5 | 2A-9078339 |
| Imidazo[1,2-a]pyrazine-2-carboxamide | 77124-59-5 | 2A-9078346 |
| (S)-1-(3-Nitrophenyl)ethanaminehydrochloride | 297730-25-7 | 2A-9078364 |
| (R)-1-(3-Nitrophenyl)ethanaminehydrochloride | 297730-27-9 | 2A-9078365 |
| 1-N-Boc-4-(3-AminoMethylpyridyl)piperidine | 206274-21-7 | 2A-9078368 |
| (S)-1,2,3,4-Tetrahydro-3-isoquinolinecarboxylicacidt-butylester | 77497-74-6 | 2A-9078406 |
| 4-Chloro-7-methyl-7H-pyrrolo[2,3-d]pyrimidine | 7781-10-4 | 2A-9078444 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA