
CAS Number20375-42-2
SynonymsAcetyl-m-cumarsaeure; 3-Acetoxy-zimtsaeure; 3-acetyloxycinnamic acid; RARECHEM BK HW 0049; 3-ACETYLCOUMARIC ACID; M-ACETYLCOUMARIC ACID; 3-acetoxy-cinnamic acid; (2E)-3-[3-(Acetyloxy)phenyl]-2-propenoic acid
Molecular FormulaC11H10O4
Molecular Weight206.2
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20375-42-2 |
| Catalog No. | 2A-9078294 |
| Chinese Name | 3-乙酸基肉桂酸 |
| Synonyms | Acetyl-m-cumarsaeure; 3-Acetoxy-zimtsaeure; 3-acetyloxycinnamic acid; RARECHEM BK HW 0049; 3-ACETYLCOUMARIC ACID; M-ACETYLCOUMARIC ACID; 3-acetoxy-cinnamic acid; (2E)-3-[3-(Acetyloxy)phenyl]-2-propenoic acid |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.2 |
| HTC | 2918990090 |
| PubChem ID | 439342 |
| MDL Number | MFCD00016842 |
| SMILES | CC(=O)Oc1cccc(C=CC(=O)O)c1 |
| InChI | InChI=1S/C11H10O4/c1-8(12)15-10-4-2-3-9(7-10)5-6-11(13)14/h2-7H,1H3,(H,13,14)/b6-5+ |
| InChI Key | LSZKRNUEKNCZIE-AATRIKPKSA-N |
| MSDS | msds/78294_1_20375_42_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Cyclopropyl-3-nitropyridin-2-amine | 290313-20-1 | 2A-9078287 |
| 2,4,6-TrimethylbenzonitrileN-oxide | 2904-57-6 | 2A-9078289 |
| 3-Tert-butylbenzenesulfonylchloride | 2905-26-2 | 2A-9078290 |
| Potassiumtrifluoromethanesulfonate | 2926-27-4 | 2A-9078292 |
| Beta-EthylphenEthylalcohol | 2035-94-1 | 2A-9078293 |
| 2-Methylamino-cyclohexanol | 20431-81-6 | 2A-9078297 |
| 5-Bromo-2,3-difluorophenetole | 204654-92-2 | 2A-9078300 |
| 4H-Pyrazolo[1,5-a]pyrimidin-7-one | 29274-23-5 | 2A-9078301 |
| 6-Methyl-heptanoate | 29355-14-4 | 2A-9078302 |
| Benzyloxyurea | 2048-50-2 | 2A-9078310 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA