
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 76838-73-8 |
| Catalog No. | 2A-9078271 |
| Chinese Name | 2-(3-氯苯氧基)苯胺 |
| Synonyms | 2-(3-Chlorophenoxy)aniline; 3'-Chlor-2-amino-diphenylaether |
| Molecular Formula | C12H10O1N1Cl1 |
| Molecular Weight | 219.67 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 321.7±27.0 °C at 760 mmHg |
| HTC | 2922299090 |
| PubChem ID | 32337960 |
| MDL Number | MFCD04970990 |
| SMILES | Nc1ccccc1Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H10ClNO/c13-9-4-3-5-10(8-9)15-12-7-2-1-6-11(12)14/h1-8H,14H2 |
| InChI Key | CADLUJRSKCJOCP-UHFFFAOYSA-N |
| MSDS | msds/78271_1_76838_73_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Glycine,N-[(1,1-dimethylethoxy)carbonyl]-N-(phenylmethyl)- | 76315-01-0 | 2A-9078241 |
| 2-Bromo-5-fluoroCinnamicacid | 202865-70-1 | 2A-9078245 |
| 5-Methoxy-2-indanone | 76413-89-3 | 2A-9078246 |
| 4-Chloro-3-fluorocinnamicacid | 202982-66-9 | 2A-9078252 |
| Tetrahydro-pyran-4-thiol | 203246-71-3 | 2A-9078265 |
| 1-(2-Bromoethoxy)-4-chlorobenzene | 2033-76-3 | 2A-9078272 |
| 4-Chlorophenylchloroformate | 7693-45-0 | 2A-9078281 |
| 4-Bromo-2-nitrocinnamicacid | 20357-30-6 | 2A-9078283 |
| 3,4-Dihydro-8-hydroxynaphthalen-1(2H)-one | 7695-47-8 | 2A-9078284 |
| 2-Chloro-4-methylbenzoicacid | 7697-25-8 | 2A-9078286 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA