
CAS Number200958-40-3
Synonyms2-Bromo-4-nitro(trifluoromethoxy)benzene; 2-Bromo-4-nitro-1-(trifluoromethoxy)benzene; 2-Bromo-4-nitrophenyl trifluoromethyl ether; MFCD04973758
Molecular FormulaC7H3BrF3NO3
Molecular Weight255.03
Density1.8±0.1 g/cm3
Boiling Point260.7±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 200958-40-3 |
| Catalog No. | 2A-9078188 |
| Chinese Name | 2-溴-4-硝基-1-(三氟甲氧基)苯 |
| Synonyms | 2-Bromo-4-nitro(trifluoromethoxy)benzene; 2-Bromo-4-nitro-1-(trifluoromethoxy)benzene; 2-Bromo-4-nitrophenyl trifluoromethyl ether; MFCD04973758 |
| Molecular Formula | C7H3BrF3NO3 |
| Molecular Weight | 255.03 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 260.7±35.0 °C at 760 mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2909309090 |
| PubChem ID | 56142595 |
| SMILES | O=[N+]([O-])c1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C7H3BrF3NO3/c8-5-3-4(12(13)14)1-2-6(5)15-7(9,10)11/h1-3H |
| InChI Key | LVTAFGFYMLODQP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methyltetrahydro-2H-pyran-4-ol | 7525-64-6 | 2A-9078168 |
| 4-Oxo-proline | 2002-02-0 | 2A-9078175 |
| 4-Chloro-Beta-methyl-benzeneethanaminehydrochloride | 75425-55-7 | 2A-9078177 |
| 1-Bromo-4-iodo-2-methoxybenzene | 755027-18-0 | 2A-9078181 |
| 4-Chloro-5-methylpyrimidin-2-amine | 20090-58-8 | 2A-9078187 |
| D-4-Isopropylphenylalanine | 755724-85-7 | 2A-9078190 |
| (4-Methoxybenzyl)hydrazinehydrochloride | 2011-48-5 | 2A-9078194 |
| 1-Methyl-1H-indazol-5-ol | 756839-14-2 | 2A-9078199 |
| 1,1,4,4-TetramethyldisilEthylene | 20152-11-8 | 2A-9078201 |
| N,N-Dimethylthioformamide | 758-16-7 | 2A-9078203 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA