
CAS Number74733-27-0
SynonymsMETHYL 4-BROMOMETHYL-2-METHOXYBENZOATE; Benzoic acid, 4-(bromomethyl)-2-methoxy-, methyl ester; Methyl 4-(bromomethyl)-2-methoxybenzoate; 4-bromomethyl-2-methoxy benzoic acid methyl ester
Molecular FormulaC10H11BrO3
Molecular Weight259.1
Density1.4±0.1 g/cm3
Boiling Point336.1±32.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 74733-27-0 |
| Catalog No. | 2A-9078133 |
| Chinese Name | 4-溴甲基-2-甲基苯甲酸甲酯 |
| Synonyms | METHYL 4-BROMOMETHYL-2-METHOXYBENZOATE; Benzoic acid, 4-(bromomethyl)-2-methoxy-, methyl ester; Methyl 4-(bromomethyl)-2-methoxybenzoate; 4-bromomethyl-2-methoxy benzoic acid methyl ester |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.1 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 336.1±32.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918990090 |
| PubChem ID | 16375747 |
| SMILES | COC(=O)c1ccc(CBr)cc1OC |
| InChI | InChI=1S/C10H11BrO3/c1-13-9-5-7(6-11)3-4-8(9)10(12)14-2/h3-5H,6H2,1-2H3 |
| InChI Key | DCXFLSHDURQRML-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 5-Chloro-1H-indole-2-boronicacid | 282528-62-5 | 2A-9078058 |
| 2-Methoxycarbonylindole-5-boronicacid | 284660-86-2 | 2A-9078069 |
| 2-(Bromomethyl)-5-nitrobenzonitrile | 288252-67-5 | 2A-9078079 |
| (4-Trifluoromethyl-pyridin-3-yl)-methanol | 198401-76-2 | 2A-9078094 |
| 2-Hydroxy-4,5-difluorobenzaldehyde | 199287-52-0 | 2A-9078116 |
| 4-(4-Methylpiperazin-1-yl)phenylboronicacid,pinacolester | 747413-21-4 | 2A-9078135 |
| [1-(4-TrifluoroMethylphenyl)-1-tosyl]methylisocyanide | 748187-71-5 | 2A-9078137 |
| 3-Imidazol-1-yl-propionaldehyde | 74917-06-9 | 2A-9078146 |
| 5-Bromo-2-trifluoromethyl-isonicotinicacid | 749875-16-9 | 2A-9078158 |
| 3-Oxo-3,4-dihydro-2H-benzo[1,4]oxazine-6-carbaldehyde | 200195-15-9 | 2A-9078173 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA