
CAS Number27151-65-1
Synonyms5-Methoxy-3-methyl-5-oxopentanoic acid; Pentanedioic acid, 3-methyl-, monomethyl ester; Monomethyl 3-methylglutarate; 3-methyl-pentanedioic acid monomethyl ester; 3-methyl-1,5-pentanedioic acid monomethyl ester; 3-Methylglutarsaeure-monomethylester; Methyl hydrogen 3-methylglutarate; methyl-4-carboxy-3-methylbutyrate; (+-)-3-methyl-glutaric acid monomethyl ester
Molecular FormulaC7H12O4
Molecular Weight160.17
Density1.1±0.1 g/cm3
Boiling Point291.6±0.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 27151-65-1 |
| Catalog No. | 2A-9077981 |
| Chinese Name | Β-甲基戊二酸单甲酯 |
| Synonyms | 5-Methoxy-3-methyl-5-oxopentanoic acid; Pentanedioic acid, 3-methyl-, monomethyl ester; Monomethyl 3-methylglutarate; 3-methyl-pentanedioic acid monomethyl ester; 3-methyl-1,5-pentanedioic acid monomethyl ester; 3-Methylglutarsaeure-monomethylester; Methyl hydrogen 3-methylglutarate; methyl-4-carboxy-3-methylbutyrate; (+-)-3-methyl-glutaric acid monomethyl ester |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 291.6±0.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918990090 |
| PubChem ID | 137124 |
| SMILES | COC(=O)CC(C)CC(=O)O |
| InChI | InChI=1S/C7H12O4/c1-5(3-6(8)9)4-7(10)11-2/h5H,3-4H2,1-2H3,(H,8,9) |
| InChI Key | BYBMHSADRRMVHY-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2-Difluoro-2-pyridin-2-ylethaneamine | 267875-68-3 | 2A-9077962 |
| N-Isopropyl-3-nitropyridin-2-amine | 26820-67-7 | 2A-9077964 |
| 2-ChlorophenEthylbromide | 16793-91-2 | 2A-9077967 |
| 2-Mercaptoacetophenone | 26824-02-2 | 2A-9077968 |
| NXY-059(Disufentonsodium) | 168021-79-2 | 2A-9077980 |
| 3-Oxo-3,4-dihydro-2H-1,4-benzothiazine-6-carboxylicacid | 272437-84-0 | 2A-9077983 |
| Myristylnicotinate | 273203-62-6 | 2A-9077991 |
| 3-Bromo-2-methylaniline,HCL | 16822-92-7 | 2A-9077993 |
| 7-Chloro-2H-1,4-benzoxazin | 27320-99-6 | 2A-9077994 |
| 8-Aminoquinolin-6-ol | 7402-16-6 | 2A-9077995 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA