
CAS Number26673-30-3
Synonyms5-CHLORO-1-TETRALONE; 5-chloro-3,4-dihydronaphthalen-1(2H)-one; 5-CHLORO-TETRAL-1-ONE; 5-chloro-l,2,3,4-tetrahydro-naphthalen-1-one; 5-Chloro-1,2,3,4-tetrahydro-1-naphthalenone; 5-chloro-3,4-dihydro-1(2H)-naphthalenone
Molecular FormulaC10H9ClO
Molecular Weight180.63
Density1.248g/cm3
Boiling Point306.151ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26673-30-3 |
| Catalog No. | 2A-9077958 |
| Chinese Name | 5-氯-Alpha-四氢萘酮 |
| Synonyms | 5-CHLORO-1-TETRALONE; 5-chloro-3,4-dihydronaphthalen-1(2H)-one; 5-CHLORO-TETRAL-1-ONE; 5-chloro-l,2,3,4-tetrahydro-naphthalen-1-one; 5-Chloro-1,2,3,4-tetrahydro-1-naphthalenone; 5-chloro-3,4-dihydro-1(2H)-naphthalenone |
| Molecular Formula | C10H9ClO |
| Molecular Weight | 180.63 |
| Density | 1.248g/cm3 |
| Boiling Point | 306.151ºC at 760 mmHg |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2914700090 |
| PubChem ID | 28673845 |
| SMILES | O=C1CCCc2c(Cl)cccc21 |
| InChI | InChI=1S/C10H9ClO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1,4-5H,2-3,6H2 |
| InChI Key | KCJYJBGXUCXUPC-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2-Diphenyl-pyrazolidine-3,5-dione | 2652-77-9 | 2A-9077946 |
| Methyl(2S)-2-amino-2-(4-hydroxyphenyl)acetate | 26531-82-8 | 2A-9077947 |
| 2-Amino-2-phenylacetonitrile | 16750-42-8 | 2A-9077948 |
| Heptanedioicacid,2-amino-,(2S)- | 26630-55-7 | 2A-9077955 |
| 2-Acetylamino-3-(2,6-difluoro-phenyl)-propionicacid | 266360-56-9 | 2A-9077957 |
| 2,2-Difluoro-2-pyridin-2-ylethaneamine | 267875-68-3 | 2A-9077962 |
| N-Isopropyl-3-nitropyridin-2-amine | 26820-67-7 | 2A-9077964 |
| 2-ChlorophenEthylbromide | 16793-91-2 | 2A-9077967 |
| 2-Mercaptoacetophenone | 26824-02-2 | 2A-9077968 |
| NXY-059(Disufentonsodium) | 168021-79-2 | 2A-9077980 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA