CAS Number162607-18-3
Synonyms5-Chloro-2-thienylboronic acid; (5-Chloro-2-thienyl)boronic acid; MFCD00236030; 5-Chloro-2-thiopheneboronic Acid; (5-chlorothiophen-2-yl)boronic acid; 5-Chlorothiophene-2-boronic acid
Molecular Formula5-(Cl)-2-(CH3)C6H3NH2
Molecular Weight141.60
Purity≥98.0 (GC)%
Density1.5±0.1 g/cm3
Boiling Point237 °C/1013 hPa
Melting Point22 °C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 162607-18-3 |
| Catalog No. | 2A-9077814 |
| Chinese Name | 5-氯-2-噻吩硼酸 |
| Synonyms | 5-Chloro-2-thienylboronic acid; (5-Chloro-2-thienyl)boronic acid; MFCD00236030; 5-Chloro-2-thiopheneboronic Acid; (5-chlorothiophen-2-yl)boronic acid; 5-Chlorothiophene-2-boronic acid |
| Molecular Formula | 5-(Cl)-2-(CH3)C6H3NH2 |
| Molecular Weight | 141.60 |
| Purity | ≥98.0 (GC) |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 237 °C/1013 hPa |
| Melting Point | 22 °C |
| Appearance | solid |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2934999090 |
| PubChem ID | 3155126 |
| MDL Number | MFCD00007779 |
| SMILES | Clc1cc(c(cc1)C)N |
| InChI | 1S/C7H8ClN/c1-5-2-3-6(8)4-7(5)9/h2-4H,9H2,1H3 |
| InChI Key | WRZOMWDJOLIVQP-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352116 |
| MSDS | msds/77814_1_162607_18_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 5-Chloro-2-thiopheneboronic acid (containing varying amounts of anhydride) Modification number: 5 |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,6-Dichloro-3-(trifluoromethyl)benzoicacid | 25922-41-2 | 2A-9077738 |
| 4-(Dimethylamino)benzohydrazide | 19353-92-5 | 2A-9077749 |
| 7-Oxa-2-azaspiro[3.5]nonane | 194157-10-3 | 2A-9077767 |
| Benzocyclobutene-4-boronicacid | 195730-31-5 | 2A-9077795 |
| 2,5-Bis(trifluoromethyl)benzeneboronicacid | 196083-18-8 | 2A-9077797 |
| 5-Methyl-2-thiopheneboronicacid | 162607-20-7 | 2A-9077816 |
| 2-(Trifluoromethyl)quinazolin-4-ol | 26059-81-4 | 2A-9077835 |
| 1-Pyrenylboronicacid | 164461-18-1 | 2A-9077860 |
| 4-(3-Chloro-phenoxy)-benzaldehyde | 164522-90-1 | 2A-9077862 |
| 4-Methyl-6-trifluoroMethylNicotinicacid | 261635-74-9 | 2A-9077881 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS