
CAS Number16208-20-1
SynonymsNaphth-1-ylglyoxal hydrate; 2-naphthyl-2-oxoethanal,hydrate; 2,2-dihydroxy-1-(naphthalen-1-yl)ethanone; 2,2-Dihydroxy-1-[1]naphthyl-aethanon; 2,2-Dihydroxy-1-(1-Naphthalenyl)-Ethanone; 1-Naphthylglyoxal hydrate; 2,2-dihydroxy-1-[1]naphthyl-ethanone; OR1617; 2-(naphthalen-1-yl)-2-oxoacetaldehyde hydrate
Molecular FormulaC12H10O3
Molecular Weight202.20600
Boiling Point401.7ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16208-20-1 |
| Catalog No. | 2A-9077723 |
| Chinese Name | 1-萘基乙二醛水合物 |
| Synonyms | Naphth-1-ylglyoxal hydrate; 2-naphthyl-2-oxoethanal,hydrate; 2,2-dihydroxy-1-(naphthalen-1-yl)ethanone; 2,2-Dihydroxy-1-[1]naphthyl-aethanon; 2,2-Dihydroxy-1-(1-Naphthalenyl)-Ethanone; 1-Naphthylglyoxal hydrate; 2,2-dihydroxy-1-[1]naphthyl-ethanone; OR1617; 2-(naphthalen-1-yl)-2-oxoacetaldehyde hydrate |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.20600 |
| Boiling Point | 401.7ºC at 760mmHg |
| HTC | 2922509090 |
| PubChem ID | 131300934 |
| InChI | InChI=1S/C12H10O3/c13-11(12(14)15)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,12,14-15H |
| InChI Key | ATHXPTSYNZKZPO-UHFFFAOYSA-N |
| MSDS | msds/77723_1_16208_20_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (2-Amino-benzyl)-carbamicacidtert-butylester | 162046-50-6 | 2A-9077716 |
| 162046-56-2 | 162046-56-2 | 2A-9077717 |
| (4-Bromopyridin-2-yl)methylacetate | 192642-94-7 | 2A-9077718 |
| Methyl6-aminohexanoatehydrochloride | 1926-80-3 | 2A-9077719 |
| Potassium(4-methoxyphenyl)trifluoroborate | 192863-36-8 | 2A-9077722 |
| Diethylthioposphoril-(Z)-(2-aminothiazol-4-yl)-(methoxyimino)acetate | 162208-27-7 | 2A-9077724 |
| Tert-Butyl2-bromobenzylcarbamate | 162356-90-3 | 2A-9077733 |
| 4-Dimethylaminobenzylamine | 19293-58-4 | 2A-9077734 |
| 1-(4-Acetylpiperidino)ethan-1-one | 162368-01-6 | 2A-9077736 |
| Benzo[E]pyrene | 192-97-2 | 2A-9077737 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA