CAS Number19040-62-1
Synonyms2,5-Dimethylbenzenesulfonyl chloride; 4-methyltoluenesulfonyl chloride; p-Xylene-2-sulfonyl chloride; p-methyltoluenesulphonyl chloride; 2,5-dimethylbenzene-1-sulfonyl chloride; 2,4-DIMETHYLPHENOXYACETIC ACID HYDRAZIDE; MFCD00024875; 2,5-dimethylphenylsulfonyl chloride; 2,5-dimethyl-benzene-sulfonyl chloride; 2,5-Dimethylbenzenesulphonyl chloride
Molecular FormulaC8H9ClO2S
Molecular Weight204.67400
Density1.29g/cm3
Boiling Point77 °C
Melting Point156-158℃
AppearanceSolid;White or Colorless to Light yellow powder to lump to clear liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 19040-62-1 |
| Catalog No. | 2A-9077664 |
| Chinese Name | 2,5-二甲基苯磺酰氯 |
| Synonyms | 2,5-Dimethylbenzenesulfonyl chloride; 4-methyltoluenesulfonyl chloride; p-Xylene-2-sulfonyl chloride; p-methyltoluenesulphonyl chloride; 2,5-dimethylbenzene-1-sulfonyl chloride; 2,4-DIMETHYLPHENOXYACETIC ACID HYDRAZIDE; MFCD00024875; 2,5-dimethylphenylsulfonyl chloride; 2,5-dimethyl-benzene-sulfonyl chloride; 2,5-Dimethylbenzenesulphonyl chloride |
| Molecular Formula | C8H9ClO2S |
| Molecular Weight | 204.67400 |
| Density | 1.29g/cm3 |
| Boiling Point | 77 °C |
| Melting Point | 156-158℃ |
| Appearance | Solid;White or Colorless to Light yellow powder to lump to clear liquid |
| Storage Condition | Sealed at room temperature, protected from light, |
| Packaging | II |
| HTC | 2904909090 |
| PubChem ID | 3217031 |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C8H9ClO2S/c1-6-3-4-7(2)8(5-6)12(9,10)11/h3-5H,1-2H3 |
| InChI Key | FZVZUIBYLZZOEW-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3261 Proper shipping name: Corrosive solid, acidic, organic, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Nitro-phenEthylaminehydrochloride | 19008-62-9 | 2A-9077658 |
| Cbz-N-methylEthylenediamine | 19023-94-0 | 2A-9077660 |
| 2-Chloro-5-nitronicotinicacidmethylester | 190271-88-6 | 2A-9077661 |
| 5-N-Propyluracil | 19030-75-2 | 2A-9077662 |
| 3-Amino-2,2-diMethylpropanoicacid | 19036-43-2 | 2A-9077663 |
| 2,3,4,5-Tetrahydro-1H-1,4-benzodiazepine | 1904-65-0 | 2A-9077665 |
| 1-(2-Nitrophenyl)methanamine | 1904-78-5 | 2A-9077666 |
| 3-Bromo-4-methoxyaniline | 19056-41-8 | 2A-9077667 |
| 6-Bromochromen-2-one | 19063-55-9 | 2A-9077668 |
| 1-Methyl-5-oxoprolinemethylester | 190783-99-4 | 2A-9077671 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS