
CAS Number18962-07-7
Synonyms(S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid; 4-Isobutoxy-benzaldehyd; 4-Isobutoxybenzaldehyde; 4-(2-methylpropoxy)benzaldehyde; p-iso-Butoxy-benzaldehyd; p-isobutoxybenzaldehyde
Molecular FormulaC15H21NO4
Molecular Weight178.23
Density1.1±0.1 g/cm3
Boiling Point441.3±38.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18962-07-7 |
| Catalog No. | 2A-9077644 |
| Chinese Name | 4-异丁氧基苯甲醛 |
| Synonyms | (S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid; 4-Isobutoxy-benzaldehyd; 4-Isobutoxybenzaldehyde; 4-(2-methylpropoxy)benzaldehyde; p-iso-Butoxy-benzaldehyd; p-isobutoxybenzaldehyde |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 178.23 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 441.3±38.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2912499000 |
| PubChem ID | 112765 |
| SMILES | CC(C)COc1ccc(C=O)cc1 |
| InChI | InChI=1S/C11H14O2/c1-9(2)8-13-11-5-3-10(7-12)4-6-11/h3-7,9H,8H2,1-2H3 |
| InChI Key | PWASYRSZCSTUIW-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-(Chloromethyl)naphthalene | 2506-41-4 | 2A-9077551 |
| 4-Bromo-2-nitro-1-(trifluoromethyl)benzene | 251115-21-6 | 2A-9077555 |
| Spiro[isochroman-1,4'-piperidin]-3-one | 252002-14-5 | 2A-9077567 |
| Ethyl5-(chloromethyl)-2-furoate | 2528-00-9 | 2A-9077583 |
| 4-Isopropoxybenzaldehyde | 18962-05-5 | 2A-9077643 |
| 4-Iodo-3-(trifluoromethyl)benzonitrile | 161320-00-9 | 2A-9077688 |
| 2-Bromo-3-methoxyisonicotinaldehyde | 191418-78-7 | 2A-9077698 |
| 2-Nitro-4-trifluoromethylbromobenzene | 162333-02-0 | 2A-9077727 |
| 9,9-Dioctylfluorene-2,7-diboronicacid | 258865-48-4 | 2A-9077728 |
| 3-Nitro-4-(trifluoromethyl)phenol | 25889-36-5 | 2A-9077730 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA