
CAS Number16096-33-6
Synonymsphenylindole; 2-phenyl-1H-indole; 1-methyl-1H-indole; N-phenyl-1H-indole; 1-Phenyl-1H-indole; 1-phenylindole; N-Phenylindole
Molecular FormulaC14H11N1
Molecular Weight193.25
Density1.1±0.1 g/cm3
Boiling Point328.6±15.0 °C at 760 mmHg
Melting Point60-62°C
AppearanceLiquid;Colorless to Yellow to Orange clear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16096-33-6 |
| Catalog No. | 2A-9077627 |
| Chinese Name | 1-苯基吲哚 |
| Synonyms | phenylindole; 2-phenyl-1H-indole; 1-methyl-1H-indole; N-phenyl-1H-indole; 1-Phenyl-1H-indole; 1-phenylindole; N-Phenylindole |
| Molecular Formula | C14H11N1 |
| Molecular Weight | 193.25 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 328.6±15.0 °C at 760 mmHg |
| Melting Point | 60-62°C |
| Appearance | Liquid;Colorless to Yellow to Orange clear liquid |
| Storage Condition | Store under inert gas; avoid air |
| HTC | 2933990090 |
| PubChem ID | 5447928 |
| MDL Number | MFCD00123280 |
| InChI | InChI=1S/C14H11N/c1-2-7-13(8-3-1)15-11-10-12-6-4-5-9-14(12)15/h1-11H |
| InChI Key | YBFCBQMICVOSRW-UHFFFAOYSA-N |
| MSDS | msds/77627_1_16096_33_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-(4-(Bromomethyl)phenyl)-5-methyl-1,2,4-oxadiazole | 256956-42-0 | 2A-9077611 |
| 3-Bromo-5-methylisoxazole | 25741-97-3 | 2A-9077612 |
| Tert-butyl4-(4-fluorobenzoyl)piperidine-1-carboxylate | 160296-40-2 | 2A-9077618 |
| 2-Methoxy-3-nitro-4-Methylpyridine | 160590-36-3 | 2A-9077621 |
| 5-Hydrazino-2-methoxypyridine | 160664-95-9 | 2A-9077623 |
| Ethyl5-aminothiazole-4-carboxylate | 18903-18-9 | 2A-9077629 |
| 4-Methyl-2-phenyl-5-thiazolecarboxylicacidmethylester | 189271-66-7 | 2A-9077634 |
| 4-Chloro-7-methoxy-2-phenylquinoline | 189816-05-5 | 2A-9077654 |
| 2-(4-Methylphenyl)benzthiazole | 16112-21-3 | 2A-9077679 |
| 2-Methylindole-3-aceticacid | 1912-43-2 | 2A-9077680 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA