
CAS Number253677-29-1
Synonyms5-CHLORO-2-((TERT-BUTOXYCARBONYL)AMINO)BENZOIC ACID; 5-Chloro-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid; Anthranilicacid,N-Boc-5-chloro; N-Boc-5-chloroanthranilic acid; 2-[(tert-Butoxycarbonyl)amino]-5-chlorobenzoic acid; 2-tert-Butoxycarbonylamino-5-chloro-benzoic acid
Molecular FormulaC12H14O4N1Cl1
Molecular Weight271.7
Density1.3±0.1 g/cm3
Boiling Point350.4±32.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 253677-29-1 |
| Catalog No. | 2A-9077588 |
| Chinese Name | 2-叔丁氧基羰氨基-5-氯苯甲酸 |
| Synonyms | 5-CHLORO-2-((TERT-BUTOXYCARBONYL)AMINO)BENZOIC ACID; 5-Chloro-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid; Anthranilicacid,N-Boc-5-chloro; N-Boc-5-chloroanthranilic acid; 2-[(tert-Butoxycarbonyl)amino]-5-chlorobenzoic acid; 2-tert-Butoxycarbonylamino-5-chloro-benzoic acid |
| Molecular Formula | C12H14O4N1Cl1 |
| Molecular Weight | 271.7 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 350.4±32.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2924299090 |
| PubChem ID | 3183798 |
| MDL Number | MFCD02682158 |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C12H14ClNO4/c1-12(2,3)18-11(17)14-9-5-4-7(13)6-8(9)10(15)16/h4-6H,1-3H3,(H,14,17)(H,15,16) |
| InChI Key | SWJIXFKVVPTMPQ-UHFFFAOYSA-N |
| MSDS | msds/77588_1_253677_29_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| [1,4']Bipiperidinyl-2-one | 159874-26-7 | 2A-9077516 |
| (2S,5R)-N-Boc-5-Methylpyrrolidine-2-carboxylicaci | 160033-52-3 | 2A-9077523 |
| 4-(1-Pyrrolidinyl)-1-butanamine | 24715-90-0 | 2A-9077529 |
| N-Boc-Aminopiperidinyl-1,1-carboxylicacid | 252720-31-3 | 2A-9077580 |
| 4-(1-Piperazinyl)-1H-pyrrolo[2,3-d]pyrimidine | 252722-52-4 | 2A-9077581 |
| 4,5,6,7-Tetrahydroisoxazolo[4,5-c]pyridine | 253682-42-7 | 2A-9077589 |
| N,N-Dimethyl-(R)-(piperidin-3-yl)methanamine | 254905-65-2 | 2A-9077596 |
| Imidazo[1,5-a]pyridine-6-carboxylicacid | 256935-76-9 | 2A-9077610 |
| (2R,3R)-2-Phenylpiperidin-3-amine | 160551-72-4 | 2A-9077620 |
| 2-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine | 189089-83-6 | 2A-9077630 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA