
CAS Number1598-63-6
Synonyms5-fluoro-2-methylpyrimidine-4,6-diol; 4,6-dihydroxy-5-fluoro-2-methylpyrimidine; 5-fluoro-4,6-dihydroxy-2-methylpyrimidine; 2-Methyl-4,6-dihydroxy-5-fluoropyrimidine
Molecular FormulaC5H5FN2O2
Molecular Weight144.10400
Density1.59g/cm3
Boiling Point267.7ºC at 760mmHg
Melting Point>310℃
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1598-63-6 |
| Catalog No. | 2A-9077514 |
| Chinese Name | 5-氟-2-甲基-4,6-二羟基嘧啶 |
| Synonyms | 5-fluoro-2-methylpyrimidine-4,6-diol; 4,6-dihydroxy-5-fluoro-2-methylpyrimidine; 5-fluoro-4,6-dihydroxy-2-methylpyrimidine; 2-Methyl-4,6-dihydroxy-5-fluoropyrimidine |
| Molecular Formula | C5H5FN2O2 |
| Molecular Weight | 144.10400 |
| Density | 1.59g/cm3 |
| Boiling Point | 267.7ºC at 760mmHg |
| Melting Point | >310℃ |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2933599090 |
| PubChem ID | 91322 |
| SMILES | Cc1nc(O)c(F)c(=O)[nH]1 |
| InChI | InChI=1S/C5H5FN2O2/c1-2-7-4(9)3(6)5(10)8-2/h1H3,(H2,7,8,9,10) |
| InChI Key | REAPDCOFEGTTLS-UHFFFAOYSA-N |
| MSDS | msds/77514_1_1598_63_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Ethyl1,2,3,4-tetrahydro-isoquinoline-3-carboxylate | 15912-55-7 | 2A-9077493 |
| 4-(Phenylmethyl)-1-piperazineaceticacid | 24632-70-0 | 2A-9077499 |
| 1-Hydroxy-2-pyridinethionesodiumsalt | 15922-78-8 | 2A-9077501 |
| 2-Methylpyridine-3,4-diamine | 15931-19-8 | 2A-9077502 |
| 1-Aminopyrrole-2-carbonitrile | 159326-66-6 | 2A-9077505 |
| 2-Chloro-6-(trifluoromethyl)benzothiazole | 159870-86-7 | 2A-9077515 |
| Methyl-2-deoxy-3,5-bis-O-(3,5-dichlorophenyl)-2E-(fluoromethylene)-α-D-erythro-pentofuranoside | 159944-91-9 | 2A-9077517 |
| Methyl-2-C-(trifluoromethyl)-α-D-ribofuranoside-3,5-diacetate | 159944-99-7 | 2A-9077518 |
| Methyl-2-deoxy-2-(trifluoromethyl)-α-D-ribofuranoside-diacetate | 159945-01-4 | 2A-9077519 |
| Methyl-2-deoxy-2-(trifluoromethyl)-α-D-arabinofuranoside-diacetate | 159945-02-5 | 2A-9077520 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA