CAS Number24552-27-0
Synonyms3-Chlor-propionsaeure-phenylester; 3-chloro-propionic acid phenyl ester; 3-CHLOROPROPANOIC ACID PHENYL ESTER; Phenyl 3-Chloropropionate; 3-Chloropropionic Acid Phenyl Ester
Molecular FormulaC9H9ClO2
Molecular Weight184.624
Density1.191g/cm3
Boiling Point270.8ºC at 760mmHg
AppearanceColorless-light yellow transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 24552-27-0 |
| Catalog No. | 2A-9077475 |
| Chinese Name | 3-氯丙酸苯酯 |
| Synonyms | 3-Chlor-propionsaeure-phenylester; 3-chloro-propionic acid phenyl ester; 3-CHLOROPROPANOIC ACID PHENYL ESTER; Phenyl 3-Chloropropionate; 3-Chloropropionic Acid Phenyl Ester |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.624 |
| Density | 1.191g/cm3 |
| Boiling Point | 270.8ºC at 760mmHg |
| Appearance | Colorless-light yellow transparent liquid |
| Storage Condition | room temperature |
| HTC | 2915900090 |
| PubChem ID | 110326 |
| MDL Number | MFCD00045298 |
| SMILES | O=C(CCCl)Oc1ccccc1 |
| InChI | InChI=1S/C9H9ClO2/c10-7-6-9(11)12-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChI Key | RAFRTSDUWORDLA-UHFFFAOYSA-N |
| MSDS | msds/77475_1_24552_27_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(Aminomethyl)pyridin-4-amine | 158531-09-0 | 2A-9077464 |
| 4-Chloro-5-nitropyridin-2-amine | 24484-96-6 | 2A-9077466 |
| N-(4-Chloropyridin-2-yl)acetamide | 245056-66-0 | 2A-9077468 |
| 3-Chloro-4-(trifluoromethoxy)benzoicacid | 158580-93-9 | 2A-9077469 |
| Methyl3-bromo-5-iodobenzoate | 188813-07-2 | 2A-9077472 |
| 1-(3-Bromo-5-nitropyridin-2-yl)hydrazine | 15862-38-1 | 2A-9077477 |
| Tert-butyln-[2-(tosyloxy)Ethyl]carbamate | 158690-56-3 | 2A-9077483 |
| 4-(Methylamino)cyclohexanone2,2-dimethyl-trimeth | 158747-10-5 | 2A-9077485 |
| Isothiozole-5-carboxylicacidmethylester | 15901-66-3 | 2A-9077490 |
| 3-Hydroxypropanesulfonicacid | 15909-83-8 | 2A-9077491 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS