
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 155020-51-2 |
| Catalog No. | 2A-9077335 |
| Chinese Name | 2,3-二氟-4-甲氧基苯胺 |
| Synonyms | 2,3-difluoro-4-methoxyphenylamine; JRD-1527 |
| Molecular Formula | C7H7O1N1F2 |
| Molecular Weight | 159.14 |
| Density | 1.281g/cm3 |
| Boiling Point | 218.5ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| PubChem ID | 5412485 |
| MDL Number | MFCD04115986 |
| SMILES | COc1ccc(N)c(F)c1F |
| InChI | InChI=1S/C7H7F2NO/c1-11-5-3-2-4(10)6(8)7(5)9/h2-3H,10H2,1H3 |
| InChI Key | MEETZAMYCFAKKW-UHFFFAOYSA-N |
| MSDS | msds/77335_1_155020_51_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Copperpyrithione | 154592-20-8 | 2A-9077324 |
| 2-Sulfoisonicotinicacid | 18616-07-4 | 2A-9077325 |
| 2-(4-Bromophenyl)-2-methyl-propionicacidmethyle | 154825-97-5 | 2A-9077329 |
| 2,7-Dibromo-9,9-diphenylfluorene | 186259-63-2 | 2A-9077330 |
| 2-Chloro-3-nitro-5-bromo-6-picoline | 186413-75-2 | 2A-9077334 |
| 8-Bromo-1,6-naphthyridin-5(6H)-one | 155057-97-9 | 2A-9077337 |
| 1,2,3,4-Tetrahydro-1,6-naphthyridin-5-ol | 155057-98-0 | 2A-9077339 |
| 2-Amino-4-chloro-5-methylbenzoicacid | 155184-81-9 | 2A-9077341 |
| 4-Fluoro-3-hydroxybenzonitrile | 186590-04-5 | 2A-9077342 |
| (2-Methyl-1-propyl-1H-indol-3-yl)(naphthalen-1-yl)methanone | 155471-08-2 | 2A-9077343 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA