
CAS Number1528-41-2
Synonymsethyl 4-cyanobenzeneacetate; ETHYL 4-CYANOPHENYLACETATE; 2-<p-cyano phenyl> acetic acid ethyl ester; p-cyanophenylacetic acid ethyl ester; Ethyl 2-(4-cyanophenyl)acetate; MFCD09953133
Molecular FormulaC11H11O2N1
Molecular Weight189.21
Density1.11g/cm3
Boiling Point304.7ºC at 760mmHg
Melting Point90-94ºC
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1528-41-2 |
| Catalog No. | 2A-9077236 |
| Chinese Name | 4-氰基-苯乙酸乙酯 |
| Synonyms | ethyl 4-cyanobenzeneacetate; ETHYL 4-CYANOPHENYLACETATE; 2-<p-cyano phenyl> acetic acid ethyl ester; p-cyanophenylacetic acid ethyl ester; Ethyl 2-(4-cyanophenyl)acetate; MFCD09953133 |
| Molecular Formula | C11H11O2N1 |
| Molecular Weight | 189.21 |
| Density | 1.11g/cm3 |
| Boiling Point | 304.7ºC at 760mmHg |
| Melting Point | 90-94ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2926909090 |
| PubChem ID | 420968 |
| MDL Number | MFCD09953133 |
| SMILES | CCOC(=O)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C11H11NO2/c1-2-14-11(13)7-9-3-5-10(8-12)6-4-9/h3-6H,2,7H2,1H3 |
| InChI Key | DFEWKWBIPMKGFG-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Methylbenzenethioamide | 2362-63-2 | 2A-9077220 |
| 2-NitrophenylN-acetyl-alpha-Dgalactosaminide | 23646-67-5 | 2A-9077226 |
| 2-Hydroxy-4-methylbenzonitrile | 18495-14-2 | 2A-9077227 |
| 2-Chloro-4-iodonicotinicacidmethylester | 185041-05-8 | 2A-9077230 |
| 6,7-Dihydro-5H-cyclopenta[b]pyridin-7-amine | 185122-75-2 | 2A-9077235 |
| 4-(Aminomethyl)-1-Methyl-4-piperidinolhydrochloride | 23804-63-9 | 2A-9077242 |
| 2-Fluoro-4-iodo-3-picoline | 153034-80-1 | 2A-9077244 |
| 2-Chloro-4-iodo-3-picoline | 153034-88-9 | 2A-9077246 |
| 2,6-Dichloro-3-hydroxyisonicotinicacid | 185422-96-2 | 2A-9077247 |
| 2-Fluoro-4-iodo-5-picoline | 153034-94-7 | 2A-9077248 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA