
CAS Number6290-24-0
SynonymsAethylaethersalicylsaeure-aethylester; 2-Aethoxy-benzoesaeure-aethylester; RARECHEM AL BI 0028; ethyl 2-ethyloxybenzoate; MFCD00142907; 2-ethoxy-benzoic acid ethyl ester; ethyl 2-ethoxy-benzoate
Molecular FormulaC11H14O3
Molecular Weight194.22700
Purity98%
Density1,07 g/cm3
Boiling Point251 °C
Melting Point-9 °C(lit.)
AppearanceColorless to light yellow to light orange transparent liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6290-24-0 |
| Catalog No. | 2A-9007723 |
| Chinese Name | 2-乙氧基苯甲酸乙酯 |
| Synonyms | Aethylaethersalicylsaeure-aethylester; 2-Aethoxy-benzoesaeure-aethylester; RARECHEM AL BI 0028; ethyl 2-ethyloxybenzoate; MFCD00142907; 2-ethoxy-benzoic acid ethyl ester; ethyl 2-ethoxy-benzoate |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.22700 |
| Purity | 98 |
| Density | 1,07 g/cm3 |
| Boiling Point | 251 °C |
| Melting Point | -9 °C(lit.) |
| Appearance | Colorless to light yellow to light orange transparent liquid |
| Storage Condition | Room Temperature |
| Packaging | III |
| HTC | 2918990090 |
| SMILES | CCOC(=O)c1ccccc1OCC |
| InChI | InChI=1S/C11H14O3/c1-3-13-10-8-6-5-7-9(10)11(12)14-4-2/h5-8H,3-4H2,1-2H3 |
| InChI Key | OUZCDRGUTZLAGO-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| MSDS | msds/7723_1_6290_24_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl 2-acetylamino-4-methylsulphonylbutanoate | 33280-93-2 | 2A-9007712 |
| Ethyl 2-amino-2-phenylacetate hydrochloride | 879-48-1 | 2A-9007713 |
| Ethyl 2-bromoacrylate | 5459-35-8 | 2A-9007719 |
| Ethyl 2-bromoisobutyrate | 600-00-0 | 2A-9007720 |
| Ethyl 2-chloronicotinate | 1452-94-4 | 2A-9007722 |
| Ethyl 2-ethylacetoacetate | 607-97-6 | 2A-9007724 |
| Ethyl 2-fluoropropionate | 349-43-9 | 2A-9007725 |
| Ethyl 2-methyl-2-Pentenoate | 58625-96-0 | 2A-9007727 |
| Ethyl 3-(N,N-dimethylamino)acrylate | 924-99-2 | 2A-9007729 |
| Ethyl 3,4-difluorobenzoylformate | 73790-05-3 | 2A-9007730 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA