
CAS Number23442-14-0
Synonymsp-aminophenacyl bromide; 1-(4-aminophenyl)-2-bromoethan-1-one; (aminophenyl)bromoethanone; 4-Bromacetyl-anilin; 4-Aminophenacyl centromide; 4'-Aminophenacyl bromide
Molecular FormulaC8H8O1N1Br1
Molecular Weight214.06
Density1.569g/cm3
Boiling Point344.4ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 23442-14-0 |
| Catalog No. | 2A-9077196 |
| Chinese Name | 4'-氨基-2-溴苯乙酮 |
| Synonyms | p-aminophenacyl bromide; 1-(4-aminophenyl)-2-bromoethan-1-one; (aminophenyl)bromoethanone; 4-Bromacetyl-anilin; 4-Aminophenacyl centromide; 4'-Aminophenacyl bromide |
| Molecular Formula | C8H8O1N1Br1 |
| Molecular Weight | 214.06 |
| Density | 1.569g/cm3 |
| Boiling Point | 344.4ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2922399090 |
| PubChem ID | 16460711 |
| MDL Number | MFCD09744997 |
| SMILES | Nc1ccc(C(=O)CBr)cc1 |
| InChI | InChI=1S/C8H8BrNO/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5,10H2 |
| InChI Key | KEDZCZPTPIYWLM-UHFFFAOYSA-N |
| MSDS | msds/77196_1_23442_14_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Methyl-2-morpholinone | 18424-96-9 | 2A-9077185 |
| 3-Fluoro-5-methoxyaniline | 2339-58-4 | 2A-9077187 |
| Tert-butyl3-Hydroxy-2,2-diMethylpropylcarbamate | 184357-44-6 | 2A-9077188 |
| 5-Chloro-2-iodobenzotrifluoride | 23399-77-1 | 2A-9077189 |
| 5-Fluoro-2,3-dihydro-1H-inden-2-amine | 2340-06-9 | 2A-9077194 |
| 2-(Quinolin-7-yl)aceticacid | 152149-07-0 | 2A-9077199 |
| 4-Amino-1,1,1-trifluoro-3-butene-2-one | 184848-89-3 | 2A-9077205 |
| 1,6-Naphthyridin-2-(1H)-one | 23616-29-7 | 2A-9077213 |
| 1,6-Naphthyridin-5(6H)-one | 23616-31-1 | 2A-9077214 |
| N,N'-Di(1-Naphthyl)benzidine | 152670-41-2 | 2A-9077216 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA