
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 151155-53-2 |
| Catalog No. | 2A-9077081 |
| Chinese Name | 2,3-二氢苯并呋喃-7-甲醇 |
| Synonyms | 2,3-Dihydrobenzo[b]furan-7-methanol; 2,3-dihydro-1-benzofuran-7-ylmethanol |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 |
| Density | 1.217g/cm3 |
| Boiling Point | 294.4ºC at 760mmHg |
| Appearance | Light yellow to yellowish brown liquid |
| Storage Condition | 2-8°C, sealed, dry |
| HTC | 2932999099 |
| PubChem ID | 3250501 |
| MDL Number | C9H10O2 |
| SMILES | OCc1cccc2c1OCC2 |
| InChI | InChI=1S/C9H10O2/c10-6-8-3-1-2-7-4-5-11-9(7)8/h1-3,10H,4-6H2 |
| InChI Key | WUXXIPOWZJYRNE-UHFFFAOYSA-N |
| MSDS | msds/77081_1_151155_53_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Chloropyrimidinehydrochloride | 179051-78-6 | 2A-9077058 |
| 8-Tert-butylchroman-4-one | 23067-79-0 | 2A-9077059 |
| Ethyl5-(4-methoxyphenyl)-1,2,4-oxadiazole-3-carboxylate | 151098-14-5 | 2A-9077071 |
| Tert-butyl4-(cyclopropylamino)piperidine-1-carboxylate | 179557-01-8 | 2A-9077074 |
| N-Methyl-4-pyrimidinemethanamine | 179873-38-2 | 2A-9077080 |
| 6-Chloro-3H-spiro[isobenzofuran-1,4'-piperidin]-3-one | 180160-40-1 | 2A-9077088 |
| 5-Chloro-3H-spiro[isobenzofuran-1,4'-piperidin]-3-one | 180160-47-8 | 2A-9077090 |
| 5-Chloro-3H-spiro[isobenzofuran-1,4'-piperidine] | 180160-48-9 | 2A-9077092 |
| 6-Chloro-3-piperidin-4-yl-1H-indole | 180160-78-5 | 2A-9077093 |
| 6-Chloro-3H-spiro[isobenzofuran-1,4'-piperidine] | 180160-93-4 | 2A-9077094 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA