![N-[4-(9-Chloro-6-hydroxy-2-azabicyclo[5.4.0]undeca-8,10,12-triene-2-carbonyl)-3-methyl-phenyl]-2-methyl-benzamide structure, CAS 150683-30-0](/structures/80000/77057_2_150683_30_0.png)
CAS Number150683-30-0
Synonyms(±)-4'-[(7-chloro-2,3,4,5-tetrahydro-5-hydroxy-1H-1-benzazepin-1-yl)carbonyl]-o-tolu-m-toluidide; Tolvaptan; UNII-21G72T1950; olvaptan; Samsca; benzazepine derivative,32
Molecular FormulaC26H25ClN2O3
Molecular Weight448.941
Purity98%%
Density1.3±0.1 g/cm3
Boiling Point594.4±50.0 °C at 760 mmHg
Melting Point219-222°C
Appearancewhite to tan
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 150683-30-0 |
| Catalog No. | 2A-9077057 |
| Chinese Name | 托伐普坦 |
| Synonyms | (±)-4'-[(7-chloro-2,3,4,5-tetrahydro-5-hydroxy-1H-1-benzazepin-1-yl)carbonyl]-o-tolu-m-toluidide; Tolvaptan; UNII-21G72T1950; olvaptan; Samsca; benzazepine derivative,32 |
| Molecular Formula | C26H25ClN2O3 |
| Molecular Weight | 448.941 |
| Purity | 98% |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 594.4±50.0 °C at 760 mmHg |
| Melting Point | 219-222°C |
| Appearance | white to tan |
| Water Solubility | DMSO: ≥15mg/mL |
| Storage Condition | Refrigerator |
| Application | Tolvaptan is an arginine vasopressin receptor 2 antagonist that inhibits AVP-induced platelet aggregation with an IC50 of 1.28 μM. |
| PubChem ID | 9372812 |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCCC(O)c3cc(Cl)ccc32)c(C)c1 |
| InChI | InChI=1S/C26H25ClN2O3/c1-16-6-3-4-7-20(16)25(31)28-19-10-11-21(17(2)14-19)26(32)29-13-5-8-24(30)22-15-18(27)9-12-23(22)29/h3-4,6-7,9-12,14-15,24,30H,5,8,13H2,1-2H3,(H,28,31)/t24-/m1/s1 |
| InChI Key | GYHCTFXIZSNGJT-UHFFFAOYSA-N |
| Transport Info | Product Name: Tolvaptan |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-2-Chloro-3-(2-methylpiperazin-1-yl)pyrazine | 313657-76-0 | 2A-9076979 |
| 3-(4-Tert-butoxycarbonylamino-phenyl)-propionicacid | 149506-05-8 | 2A-9076981 |
| (S)-4-Benzyl-2-HydroxyMethylpiperazine | 149715-45-7 | 2A-9076985 |
| (R)-4-Benzyl-2-HydroxyMethylpiperazine | 149715-46-8 | 2A-9076986 |
| PhenylEthylisothiocyanate | 4478-92-6 | 2A-9077010 |
| 3,3,5-Tribromo-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | 183208-32-4 | 2A-9077148 |
| 6-Methyl-5-azaindole | 183586-34-7 | 2A-9077157 |
| 5-(Tert-Butoxycarbonyl)-2-methoxyisonicotinicacid | 183741-86-8 | 2A-9077164 |
| 1-N-Boc-1,2-Cis-cyclohexyldiamine | 184954-75-4 | 2A-9077228 |
| (S)-2-Amino-4-(4-hydroxyphenyl)butyricacid | 185062-84-4 | 2A-9077233 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA