![3-Methylbenzo[b]thiophene-2-aceticacid structure, CAS 1505-52-8](/structures/80000/77054_1_1505_52_8.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1505-52-8 |
| Catalog No. | 2A-9077054 |
| Chinese Name | 3-甲基苯并[B]噻吩-2-乙酸 |
| Synonyms | MFCD00052299; 3-Methylbenzo[b]thiophene-2-acetic acid |
| Molecular Formula | C9H7S1I1 |
| Molecular Weight | 274.13 |
| Density | 1.315g/cm3 |
| Boiling Point | 391.8ºC at 760mmHg |
| Melting Point | 148-150°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2934999090 |
| PubChem ID | 3217068 |
| MDL Number | MFCD28679525 |
| SMILES | Cc1c(CC(=O)O)sc2ccccc12 |
| InChI | InChI=1S/C11H10O2S/c1-7-8-4-2-3-5-9(8)14-10(7)6-11(12)13/h2-5H,6H2,1H3,(H,12,13)/p-1 |
| InChI Key | MFVMWBIORCNCNB-UHFFFAOYSA-N |
| MSDS | msds/77054_1_1505_52_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Amino-4,5-dimethylthiazole | 2289-75-0 | 2A-9077032 |
| 1,2,4-Thiadiazole-3-aceticacid,5-[(ethoxycarbonyl)amino]-,methylester | 150215-07-9 | 2A-9077036 |
| (3S)-3-Aminomethyl-1-benzylpyrrolidine | 229323-07-3 | 2A-9077040 |
| 3-Thiomorpholinecarboxylicacid,5-methyl-,1-oxide | 15042-85-0 | 2A-9077045 |
| 1-(2,5-DiMethyl-4-oxazolyl)ethanone | 23000-12-6 | 2A-9077046 |
| 4-Chloropyrimidinehydrochloride | 179051-78-6 | 2A-9077058 |
| 8-Tert-butylchroman-4-one | 23067-79-0 | 2A-9077059 |
| Ethyl5-(4-methoxyphenyl)-1,2,4-oxadiazole-3-carboxylate | 151098-14-5 | 2A-9077071 |
| Tert-butyl4-(cyclopropylamino)piperidine-1-carboxylate | 179557-01-8 | 2A-9077074 |
| N-Methyl-4-pyrimidinemethanamine | 179873-38-2 | 2A-9077080 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA