CAS Number22921-76-2
SynonymsMFCD00017893; 2-bromoethyl 4-methoxyphenyl ether
Molecular FormulaC9H11BrO2
Molecular Weight231.09
Density1.382 g/cm3
Boiling Point140-142ºC (10 mmHg) ，291.7ºC at 760 mmHg
Melting Point46-50ºC
AppearanceOff-white to pink-beige crystalline powder, crystals or chunks
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22921-76-2 |
| Catalog No. | 2A-9077039 |
| Chinese Name | 1-(2-溴乙氧基)-4-甲氧基苯 |
| Synonyms | MFCD00017893; 2-bromoethyl 4-methoxyphenyl ether |
| Molecular Formula | C9H11BrO2 |
| Molecular Weight | 231.09 |
| Density | 1.382 g/cm3 |
| Boiling Point | 140-142ºC (10 mmHg) ，291.7ºC at 760 mmHg |
| Melting Point | 46-50ºC |
| Appearance | Off-white to pink-beige crystalline powder, crystals or chunks |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2909309090 |
| PubChem ID | 594172 |
| SMILES | COc1ccc(OCCBr)cc1 |
| InChI | InChI=1S/C9H11BrO2/c1-11-8-2-4-9(5-3-8)12-7-6-10/h2-5H,6-7H2,1H3 |
| InChI Key | PRRJGZRMBVOTGG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,3-Benzoxazol-2(3H)-one | 22876-17-1 | 2A-9077030 |
| 3,4-Dihydro-1H-2-benzopyran-1-aceticacid | 22901-11-7 | 2A-9077033 |
| Cyclodecanone | 1502-06-3 | 2A-9077035 |
| 2-Hydroxy-3-methyl-3-buten-1-oicacid | 150282-01-2 | 2A-9077037 |
| 2-Cyano-N-Ethylacetamide | 15029-36-4 | 2A-9077038 |
| Methyl-(2-p-tolyl-Ethyl)-amine | 229621-74-3 | 2A-9077041 |
| N-Carbobenzyloxy-2-methylalanine | 15030-72-5 | 2A-9077042 |
| 3-Morpholino-1-phenylpropan-1-one | 2298-48-8 | 2A-9077043 |
| 4-Chloro-2-nitrobenzylalcohol | 22996-18-5 | 2A-9077044 |
| 2,3,6-Trifluorobenzylamine | 230295-09-7 | 2A-9077047 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS