CAS Number1498-96-0
SynonymsEINECS 216-104-6; 4-Butoxybenzoic acid; 4-butoxybenzoic_acid; MFCD00002546; P-BUTOXYBENZOIC ACID
Molecular FormulaC11H14O3
Molecular Weight194.227
Density1.1±0.1 g/cm3
Boiling Point319.0±15.0 °C at 760 mmHg
Melting Point147-150 °C(lit.)
AppearanceWhite-off-white crystal-powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1498-96-0 |
| Catalog No. | 2A-9076991 |
| Chinese Name | 4-丁氧基苯甲酸 |
| Synonyms | EINECS 216-104-6; 4-Butoxybenzoic acid; 4-butoxybenzoic_acid; MFCD00002546; P-BUTOXYBENZOIC ACID |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.227 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 319.0±15.0 °C at 760 mmHg |
| Melting Point | 147-150 °C(lit.) |
| Appearance | White-off-white crystal-powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2918990090 |
| PubChem ID | 108286 |
| SMILES | CCCCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H14O3/c1-2-3-8-14-10-6-4-9(5-7-10)11(12)13/h4-7H,2-3,8H2,1H3,(H,12,13) |
| InChI Key | LAUFPZPAKULAGB-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 4-Butoxybenzoic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 8-Nonynoicacid | 30964-01-3 | 2A-9076957 |
| 4-Phenoxybenzonitrile | 3096-81-9 | 2A-9076958 |
| 4-Cyanobenzenesulphonamide | 3119-02-6 | 2A-9076968 |
| 2-(5-Bromopyridin-2-yl)acetonitrile | 312325-72-7 | 2A-9076971 |
| Methyl2-Amino-3-nitro-benzamide | 313279-12-8 | 2A-9076976 |
| 3-Bromo-2-fluorobenzadehyde | 149947-15-9 | 2A-9076992 |
| Tert-Butylbut-3-ynylcarbamate | 149990-27-2 | 2A-9076994 |
| Dibenzylmalonate | 15014-25-2 | 2A-9076996 |
| 2-Fluoro-4-(hydroxymethyl)benzonitrile | 222978-02-1 | 2A-9076997 |
| Tri-propylphosphine | 2234-97-1 | 2A-9077000 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS