
CAS Number306960-74-7
Synonyms4-Methyl-2-(trifluoromethyl)-5-pyrimidinecarboxylic acid; 4-methyl-2-trifluoromethylpyrimidine-5-carboxylic acid; 4-Methyl-2-(trifluoromethyl)pyrimidine-5-carboxylic acid
Molecular FormulaC7H5F3N2O2
Molecular Weight206.12
Density1.5±0.1 g/cm3
Boiling Point236.8±40.0 °C at 760 mmHg
Melting Point>210℃
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 306960-74-7 |
| Catalog No. | 2A-9076948 |
| Chinese Name | 2-三氟甲基嘧啶-5-羧酸 |
| Synonyms | 4-Methyl-2-(trifluoromethyl)-5-pyrimidinecarboxylic acid; 4-methyl-2-trifluoromethylpyrimidine-5-carboxylic acid; 4-Methyl-2-(trifluoromethyl)pyrimidine-5-carboxylic acid |
| Molecular Formula | C7H5F3N2O2 |
| Molecular Weight | 206.12 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 236.8±40.0 °C at 760 mmHg |
| Melting Point | >210℃ |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933599090 |
| PubChem ID | 15537738 |
| SMILES | Cc1nc(C(F)(F)F)ncc1C(=O)O |
| InChI | InChI=1S/C7H5F3N2O2/c1-3-4(5(13)14)2-11-6(12-3)7(8,9)10/h2H,1H3,(H,13,14) |
| InChI Key | BURXOXYGSJVOBI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-Methyl-D3-2-nitro-6-phenylimidazo[4,5-b]pyridine | 303173-40-2 | 2A-9076930 |
| 1-Methyl-4-nitroimidazole | 3034-41-1 | 2A-9076932 |
| Ethyl2-(trifluoromethyl)pyrimidine-5-carboxylate | 304693-64-9 | 2A-9076937 |
| 4-Methoxy-benzothiazole | 3048-46-2 | 2A-9076938 |
| Ethyl2-amino-4-(4-bromophenyl)-3-thiophenecarboxylate | 306934-99-6 | 2A-9076945 |
| Ethyl2-hydroxypyrimidine-4-carboxylate | 306961-02-4 | 2A-9076949 |
| 3-(Chloromethyl)pyridine | 3099-31-8 | 2A-9076959 |
| 2,6-DichloroMethylpyridinehydrochloride | 3099-50-1 | 2A-9076960 |
| (3S)-N,N-Dimethy-3-piperidinecarboxamide | 310455-02-8 | 2A-9076963 |
| 5-Fluoro-1H-indole-3-carboxylicacidmethylester | 310886-79-4 | 2A-9076965 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA