![2,6-Bis[(2-hydroxyEthyl)amino]toluene structure, CAS 149330-25-6](/structures/80000/76765_1_149330_25_6.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 149330-25-6 |
| Catalog No. | 2A-9076765 |
| Chinese Name | N,N-二(2-羟乙基)-2-甲基-1,3-苯二胺 |
| Synonyms | 2-[3-(2-hydroxyethylamino)-2-methylanilino]ethanol; 2,6-Bis[(2-hydroxyethyl)amino]toluene; MFCD08703311 |
| Molecular Formula | C11H18O2N2 |
| Molecular Weight | 210.28 |
| Density | 1.217 |
| Boiling Point | 463.454ºC at 760 mmHg |
| Melting Point | 117 °C |
| Appearance | off-white powder |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Store under inert gas; avoid air |
| HTC | 2922199090 |
| PubChem ID | 15121175 |
| MDL Number | MFCD08703311 |
| SMILES | Cc1c(NCCO)cccc1NCCO |
| InChI | InChI=1S/C11H18N2O2/c1-9-10(12-5-7-14)3-2-4-11(9)13-6-8-15/h2-4,12-15H,5-8H2,1H3 |
| InChI Key | FGYCMSFOZIRDLN-UHFFFAOYSA-N |
| MSDS | msds/76765_1_149330_25_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| Lauricdiethanolamide | 120-40-1 | 2A-9076022 |
| Benzenemethanol,2-bromo-6-methyl- | 1055969-07-7 | 2A-9076163 |
| Nitrocyclohexane | 1122-60-7 | 2A-9076337 |
| (3,3-Dimethoxycyclobutyl)methanol | 175021-11-1 | 2A-9076402 |
| (Tetrahydro-pyran-3-yl)-methanol | 14774-36-8 | 2A-9076730 |
| 1,3-Oxazol-2-yl-methanol | 130551-92-7 | 2A-9076775 |
| 1,1,1,3,3,3-Hexafluoroacetonesesquihydrate | 13098-39-0 | 2A-9076781 |
| N-Cyclohexanebutyrylglycine | 132422-42-5 | 2A-9076819 |
| 2-Amino-6-fluorobenzeneethanol | 132715-66-3 | 2A-9076820 |
| 3-Chloro-4-methoxytoluene | 22002-44-4 | 2A-9076852 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA