
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 147404-72-6 |
| Catalog No. | 2A-9076720 |
| Chinese Name | 4'-(溴甲基)-[1,1'-联苯]-2-甲酰胺 |
| Synonyms | Exact Mass 289.01000; PSA 43.09000; LogP 4.04770; Index of Refraction 1.632; InChIKey POWXVFIRWRUILN-UHFFFAOYSA-N |
| Molecular Formula | C14H12O1N1Br1 |
| Molecular Weight | 290.16 |
| Density | 1.429 |
| Boiling Point | 442.1ºC at 760 mmHg |
| Appearance | solid |
| Storage Condition | 2-8°C, inert gas |
| HTC | 2924299090 |
| PubChem ID | 30970769 |
| MDL Number | MFCD11865373 |
| SMILES | NC(=O)c1ccccc1-c1ccc(CBr)cc1 |
| InChI | InChI=1S/C14H12BrNO/c15-9-10-5-7-11(8-6-10)12-3-1-2-4-13(12)14(16)17/h1-8H,9H2,(H2,16,17) |
| InChI Key | POWXVFIRWRUILN-UHFFFAOYSA-N |
| MSDS | msds/76720_1_147404_72_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4,5-Difluoro-2-methoxybenzaldehyde | 145742-34-3 | 2A-9076651 |
| (4-Nitrophenyl)acetaldehyde | 1460-05-5 | 2A-9076657 |
| 2-Fluoro-6-methoxybenzaldehyde | 146137-74-8 | 2A-9076664 |
| 4-Bromomethyl-3-fluorobenzoicacidmethylester | 128577-47-9 | 2A-9076682 |
| 2-Methoxy-5-(trifluoromethyl)benzaldehyde | 146539-83-5 | 2A-9076684 |
| Tert-butyl1-oxa-6-azaspiro[2,5]octane-6-carboxylate | 147804-30-6 | 2A-9076731 |
| DifluoroMethylphosphonicacidDiethylester | 1478-53-1 | 2A-9076733 |
| 2-Ethoxy-1-naphthaleneboronicacid | 148345-64-6 | 2A-9076741 |
| 3-(Methylsulfonamido)phenylboronicacid | 148355-75-3 | 2A-9076742 |
| 2,6-Dichloropyridin-3-ylboronicacid | 148493-34-9 | 2A-9076747 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA