
CAS Number1138-56-3
Synonymspara-n-butoxyphenylsulfonyl chloride; 4-Butoxybenzenesulfonyl chloride; p-n-butoxybenzenesulfonyl chloride; 4-(n-butoxy)-benzenesulfonyl chloride; 4-butoxybenzene-1-sulfonyl chloride; MFCD00052344; 4-Butoxybenzenesulfonylchloride; 4-(n-butoxy)-phenylsulfonyl chloride; 4-(N-butoxy)benzenesulphonyl chloride
Molecular FormulaC10H13O3Cl1S1
Molecular Weight248.73
Density1.2±0.1 g/cm3
Boiling Point354.0±15.0 °C at 760 mmHg
Melting Point19 °C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1138-56-3 |
| Catalog No. | 2A-9076644 |
| Chinese Name | 4-丁氧基苯磺酰氯 |
| Synonyms | para-n-butoxyphenylsulfonyl chloride; 4-Butoxybenzenesulfonyl chloride; p-n-butoxybenzenesulfonyl chloride; 4-(n-butoxy)-benzenesulfonyl chloride; 4-butoxybenzene-1-sulfonyl chloride; MFCD00052344; 4-Butoxybenzenesulfonylchloride; 4-(n-butoxy)-phenylsulfonyl chloride; 4-(N-butoxy)benzenesulphonyl chloride |
| Molecular Formula | C10H13O3Cl1S1 |
| Molecular Weight | 248.73 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 354.0±15.0 °C at 760 mmHg |
| Melting Point | 19 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2909309090 |
| PubChem ID | 3161041 |
| MDL Number | MFCD00052344 |
| SMILES | CCCCOc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C10H13ClO3S/c1-2-3-8-14-9-4-6-10(7-5-9)15(11,12)13/h4-7H,2-3,8H2,1H3 |
| InChI Key | HGKWMUBXVMFXNC-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/76644_1_1138_56_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromo-2-chloropicoline | 128071-86-3 | 2A-9076637 |
| (Benzo[b]thiophen-3-yl)aceticacid | 1131-09-5 | 2A-9076638 |
| Tert-Butyl2-(Ethylamino)Ethylcarbamate | 113283-93-5 | 2A-0202115 |
| 2,3,6,7-TetraMethylNaphthalene | 1134-40-3 | 2A-9076641 |
| Tert-butylN-(2-hydroxy-1-methoxyEthyl)carbamate | 113525-88-5 | 2A-9076642 |
| 2,3-Difluorophenylacetonitrile | 145689-34-5 | 2A-9076648 |
| 3,5-Dibromobenzylalcohol | 145691-59-4 | 2A-9076649 |
| 2-(3,4-Dimethoxy)-thioacetamide | 145736-65-8 | 2A-9076650 |
| 3,5-Dimethoxy-4-phenylmethoxybenzoate | 14588-60-4 | 2A-9076652 |
| N-(3-Iodo-2-pyridinyl-tert-butanamide | 113975-31-8 | 2A-9076656 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA