
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 127675-46-1 |
| Catalog No. | 2A-9076634 |
| Chinese Name | 3-氯-2,4-二氟苯甲醛 |
| Synonyms | MFCD04116001; 3-chloro-2,4-difluorobenzaldehyde |
| Molecular Formula | C7H3ClF2O |
| Molecular Weight | 176.55 |
| Density | 1.453g/cm3 |
| Boiling Point | 217.9ºC at 760 mmHg |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2913000090 |
| PubChem ID | 5205047 |
| SMILES | O=Cc1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C7H3ClF2O/c8-6-5(9)2-1-4(3-11)7(6)10/h1-3H |
| InChI Key | PDBQQCWWJXDNJO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2-(2,4-Difluorophenyl)-2-propenol | 14113-36-2 | 2A-9076160 |
| 2,4-Dichloro-imidazo[5,1-f][1,2,4]triazine | 1086398-79-9 | 2A-9076277 |
| 2,4-Dimethoxy-1-fluoro-benzene | 17715-70-7 | 2A-9076521 |
| 2-Acetoxy-2,4-difluoroacetophenone | 1222263-03-0 | 2A-9076579 |
| 2,4-Difluoro-5-nitrobenzoicacidmethylester | 125568-71-0 | 2A-9076611 |
| 2,4-Bis(p-tolylthio)-1,3-dithia-2,4-diphosphetane-2,4-disulfide | 114234-09-2 | 2A-9076667 |
| 2,4-Dichloro-5-methyl-5H-pyrrolo[3,2-D]pyrimidine | 129872-81-7 | 2A-9076700 |
| 5-((2,4-Dichlorophenoxy)methyl)-4H-1,2,4-triazole-3-thiol | 130087-63-7 | 2A-9076718 |
| 2,4-Dinitropyridine | 14916-61-1 | 2A-9076760 |
| N-2,6-DiMethylphenyl-2-chloroacetamide | 1311-01-7 | 2A-9076787 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA